Learn More
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, Electrophoresis Grade, 99.4+%
CAS: 60-00-4 | C10H16N2O8 | 292.24 g/mol
$58.97 - $575.49
Chemical Identifiers
| CAS | 60-00-4 |
|---|---|
| Molecular Formula | C10H16N2O8 |
| Molecular Weight (g/mol) | 292.24 |
| MDL Number | MFCD00003541 |
| InChI Key | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| Synonym | edta, edetic acid, ethylenediaminetetraacetic acid, edathamil, versene, endrate, havidote, titriplex, edta acid, sequestrol |
| PubChem CID | 6049 |
| ChEBI | CHEBI:42191 |
| SMILES | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAJ6558522
|
Thermo Scientific Chemicals
J6558522 |
100 g |
Each for $58.97
|
|
|||||
|
AAJ6558536
|
Thermo Scientific Chemicals
J6558536 |
500 g |
Each for $154.47
|
|
|||||
|
AAJ65585A4
|
Thermo Scientific Chemicals
J65585A4 |
2.5 kg |
Each for $575.49
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 60-00-4 | |
| 292.24 | |
| KCXVZYZYPLLWCC-UHFFFAOYSA-N | |
| 6049 | |
| OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| C10H16N2O8 | |
| MFCD00003541 | |
| edta, edetic acid, ethylenediaminetetraacetic acid, edathamil, versene, endrate, havidote, titriplex, edta acid, sequestrol | |
| CHEBI:42191 |
Specifications
| 60-00-4 | |
| White | |
| C10H16N2O8 | |
| MFCD00003541 | |
| 1716295 | |
| edta, edetic acid, ethylenediaminetetraacetic acid, edathamil, versene, endrate, havidote, titriplex, edta acid, sequestrol | |
| OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O | |
| 292.24 | |
| CHEBI:42191 | |
| ≥99.4% | |
| Powder |
| ∽245°C (decomposition) | |
| 0.68 | |
| (HO2CCH2)2NCH2CH2N(CH2CO2H)2 | |
| 100 g | |
| 143517 | |
| KCXVZYZYPLLWCC-UHFFFAOYSA-N | |
| 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid | |
| 6049 | |
| 292.24 | |
| Electrophoresis | |
| Ethylenediaminetetraacetic acid |
Safety and Handling
Causes serious eye irritation, Harmful if inhaled, May cause damage to organs through prolonged or repeated exposure if inhaled
Serious eye damage/eye irritation (category 2), Acute toxicity (category 4), Specific target organ toxicity after repeated exposure (category 2)
EINECSNumber : 200-449-4
RTECSNumber : AH4025000
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only