Learn More
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, 99%, pure
CAS: 60-00-4 | C10H16N2O8 | 292.24 g/mol
Supplier: Thermo Scientific Chemicals 118430050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Ethylenediaminetetraacetic acid | |
| 220.0°C | |
| ∼2 to 3 (sat. soln. aq. soln.) | |
| Authentic | |
| Plastic drum | |
| (HO2CCH2)2NCH2CH2N(CH2CO2H)2 | |
| 5 kg | |
| 15,3565 | |
| Solubility in water: 0.5g/L (20°C) - 2.2g/L (80°C). Other solubilities: insoluble in common organic solvents, insoluble in dilute ammonium hydroxide: 0.005% max | |
| OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O | |
| 292.24 | |
| CHEBI:42191 | |
| 99% | |
| Fine Crystalline Powder |
| 60-00-4 | |
| White | |
| >100°C | |
| 98.5% min. (Complexometry) | |
| C10H16N2O8 | |
| MFCD00003541 | |
| 01,373 | |
| edta, edetic acid, ethylenediaminetetraacetic acid, edathamil, versene, endrate, havidote, titriplex, edta acid, sequestrol | |
| KCXVZYZYPLLWCC-UHFFFAOYSA-N | |
| 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid | |
| 6049 | |
| 292.23 | |
| Pure |
Chemical Identifiers
| 60-00-4 | |
| 292.24 | |
| KCXVZYZYPLLWCC-UHFFFAOYSA-N | |
| 6049 | |
| 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid |
| C10H16N2O8 | |
| MFCD00003541 | |
| edta, edetic acid, ethylenediaminetetraacetic acid, edathamil, versene, endrate, havidote, titriplex, edta acid, sequestrol | |
| CHEBI:42191 | |
| OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
Safety and Handling
GHS H Statement
Causes serious eye irritation.
Harmful if inhaled.
GHS P Statement
Wear protective gloves/protective clothing.
IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing.
Call a POISON CENTER or doctor/physician if you feel unwell.
IF IN EYES: Rinse cau
GHS Signal Word: Warning
EINECSNumber : 200-449-4
RUO – Research Use Only