missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Ethylenediamine Tetraacetic Acid, ACS, MP Biomedicals™
Ethylenediamine Tetraacetic Acid, ACS is an ACS grade buffer component and chelating agent.
$77.35 - $184.36
Chemical Identifiers
| CAS | 60-00-4 |
|---|---|
| Molecular Formula | C10H16N2O8 |
| Molecular Weight (g/mol) | 292.24 |
| MDL Number | MFCD00003541 |
| InChI Key | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| Synonym | edta, edetic acid, ethylenediaminetetraacetic acid, edathamil, versene, endrate, havidote, titriplex, edta acid, sequestrol |
| PubChem CID | 6049 |
| ChEBI | CHEBI:42191 |
| IUPAC Name | 2-({2-[bis(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetic acid |
| SMILES | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
ICN15252180
|
MP Biomedicals Inc
0215252180 |
100 g |
Each for $77.35
|
|
|||||
|
ICN15252190
|
MP Biomedicals Inc
0215252190 |
500 g |
Each for $184.36
|
|
|||||
Description
- Ethylenediamine tetraacetic acid (EDTA) is a calcium chelator used to eliminate inhibition of enzyme catalyzed reactions due to traces of heavy metals.
- For use as an anticoagulant, disodium or tripotassium salts of EDTA are most commonly used.
- EDTA prevents platelet aggregation and is therefore the preferred anticoagulant for platelet counts.
- EDTA is an inhibitor of metalloproteases and metal-activated proteases at an effective concentration of 1 to 10 μM.
- It acts as a chelator of the zinc ion in the active site of metalloproteases, but EDTA can also inhibit other metal ion-dependent proteases such as calcium-dependent cysteine proteases.
- EDTA interferes with biological processes which are metal-dependent.
- It is a buffer component.
Chemical Identifiers
| 60-00-4 | |
| 292.24 | |
| KCXVZYZYPLLWCC-UHFFFAOYSA-N | |
| 6049 | |
| 2-({2-[bis(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetic acid |
| C10H16N2O8 | |
| MFCD00003541 | |
| edta, edetic acid, ethylenediaminetetraacetic acid, edathamil, versene, endrate, havidote, titriplex, edta acid, sequestrol | |
| CHEBI:42191 | |
| OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
Specifications
| 60-00-4 | |
| 650 kg/m3 | |
| C10H16N2O8 | |
| 100 g | |
| Soluble in water. 1.0X10+6 mg/L (miscible) at 25°C | |
| OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O | |
| 292.24 | |
| CHEBI:42191 | |
| 7.57X10-17 mm Hg at 25°C | |
| ACS Grade | |
| Chelating agent, Buffer Component |
| White | |
| >100°C | |
| MFCD00003541 | |
| edta, edetic acid, ethylenediaminetetraacetic acid, edathamil, versene, endrate, havidote, titriplex, edta acid, sequestrol | |
| KCXVZYZYPLLWCC-UHFFFAOYSA-N | |
| 2-({2-[bis(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetic acid | |
| 6049 | |
| 292.2 | |
| ≥99.4% | |
| Powder | |
| Ethylenediamine Tetraacetic Acid |
Unless specified otherwise, MP Biomedical's products are for research or further manufacturing use only, not for direct human use.