missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Ethylenediamine Tetraacetic Acid (Certified ACS), Fisher Chemical™
Supplier: Fisher Chemical E478500
Specifications
| Ethylenediamine Tetraacetic Acid | |
| 220°C | |
| 0.86g/mL | |
| 0.2% max. | |
| Glass Bottle | |
| (HOOCCH2)2NCH2CH2N(CH2COOH)2 | |
| 500 g | |
| 0.005% max. Insoluble in NH4OH | |
| OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O | |
| 292.24 | |
| CHEBI:42191 | |
| 0.013 hPa at 20°C | |
| Certified ACS |
| 60-00-4 | |
| White | |
| 2.5 | |
| 99.4 to 100.6% | |
| C10H16N2O8 | |
| MFCD00003541 | |
| edta, edetic acid, ethylenediaminetetraacetic acid, edathamil, versene, endrate, havidote, titriplex, edta acid, sequestrol | |
| KCXVZYZYPLLWCC-UHFFFAOYSA-N | |
| 2-({2-[bis(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetic acid | |
| 6049 | |
| 292.25 | |
| 99.4 to 100.6% | |
| Powder or Solid |
Chemical Identifiers
| 60-00-4 | |
| 292.24 | |
| KCXVZYZYPLLWCC-UHFFFAOYSA-N | |
| 6049 | |
| 2-({2-[bis(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetic acid |
| C10H16N2O8 | |
| MFCD00003541 | |
| edta, edetic acid, ethylenediaminetetraacetic acid, edathamil, versene, endrate, havidote, titriplex, edta acid, sequestrol | |
| CHEBI:42191 | |
| OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
Safety and Handling