missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Ethylenebis(oxyethylenenitrilo)tetraacetic acid, 98%
CAS: 67-42-5 | C14H24N2O10 | 380.34 g/mol
Supplier: Thermo Scientific Chemicals 409910250
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chelation/Complexation reagentSpecifications
| Ethylenebis(oxyethylenenitrilo)tetraacetic acid | |
| 240.0°C to 245.0°C | |
| >200°C | |
| 98% | |
| C14H24N2O10 | |
| MFCD00004291 | |
| 04, IV, 2433 | |
| egta, egtazic acid, gedta, ethylenebis oxyethylenenitrilo tetraacetic acid, ebonta, 6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl, 1,2-bis 2-bis carboxymethyl amino ethoxy ethane, ethylene glycol tetraacetic acid, h4egta, egtazic acid usan:inn | |
| DEFVIWRASFVYLL-UHFFFAOYSA-N | |
| 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid | |
| 6207 | |
| 380.34 | |
| Crystalline Powder |
| 67-42-5 | |
| White | |
| Authentic | |
| Plastic bottle | |
| [-CH2OCH2CH2N(CH2CO2H)2]2 | |
| 25 g | |
| 15, 3576 | |
| Solubility in water: slightly soluble | |
| C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O | |
| 380.34 | |
| CHEBI:30740 | |
| 98% |
Chemical Identifiers
| 67-42-5 | |
| 380.34 | |
| DEFVIWRASFVYLL-UHFFFAOYSA-N | |
| 6207 | |
| 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid |
| C14H24N2O10 | |
| MFCD00004291 | |
| egta, egtazic acid, gedta, ethylenebis oxyethylenenitrilo tetraacetic acid, ebonta, 6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl, 1,2-bis 2-bis carboxymethyl amino ethoxy ethane, ethylene glycol tetraacetic acid, h4egta, egtazic acid usan:inn | |
| CHEBI:30740 | |
| C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
Safety and Handling
EINECSNumber : 200-651-2
RUO – Research Use Only