missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Ethylenebis(oxyethylenenitrilo)tetraacetic acid, 98%
CAS: 67-42-5 | C14H24N2O10 | 380.34 g/mol
$214.79 - $595.92
Chemical Identifiers
| CAS | 67-42-5 |
|---|---|
| Molecular Formula | C14H24N2O10 |
| Molecular Weight (g/mol) | 380.34 |
| MDL Number | MFCD00004291 |
| InChI Key | DEFVIWRASFVYLL-UHFFFAOYSA-N |
| Synonym | egta, egtazic acid, gedta, ethylenebis oxyethylenenitrilo tetraacetic acid, ebonta, 6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl, 1,2-bis 2-bis carboxymethyl amino ethoxy ethane, ethylene glycol tetraacetic acid, h4egta, egtazic acid usan:inn |
| PubChem CID | 6207 |
| ChEBI | CHEBI:30740 |
| IUPAC Name | 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid |
| SMILES | C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC409910250
|
Thermo Scientific Chemicals
409910250 |
25 g | Plastic bottle |
Each for $214.79
|
|
||||
|
AC409911000
|
Thermo Scientific Chemicals
409911000 |
100 g | Plastic bottle |
Each for $595.92
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chelation/Complexation reagentChemical Identifiers
| 67-42-5 | |
| 380.34 | |
| DEFVIWRASFVYLL-UHFFFAOYSA-N | |
| 6207 | |
| 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid |
| C14H24N2O10 | |
| MFCD00004291 | |
| egta, egtazic acid, gedta, ethylenebis oxyethylenenitrilo tetraacetic acid, ebonta, 6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl, 1,2-bis 2-bis carboxymethyl amino ethoxy ethane, ethylene glycol tetraacetic acid, h4egta, egtazic acid usan:inn | |
| CHEBI:30740 | |
| C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
Specifications
| 67-42-5 | |
| White | |
| Authentic | |
| Plastic bottle | |
| [-CH2OCH2CH2N(CH2CO2H)2]2 | |
| 25 g | |
| 15, 3576 | |
| Solubility in water: slightly soluble | |
| C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O | |
| 380.34 | |
| CHEBI:30740 | |
| 98% | |
| Ethylenebis(oxyethylenenitrilo)tetraacetic acid |
| 240.0°C to 245.0°C | |
| >200°C | |
| 98% | |
| C14H24N2O10 | |
| MFCD00004291 | |
| 04, IV, 2433 | |
| egta, egtazic acid, gedta, ethylenebis oxyethylenenitrilo tetraacetic acid, ebonta, 6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl, 1,2-bis 2-bis carboxymethyl amino ethoxy ethane, ethylene glycol tetraacetic acid, h4egta, egtazic acid usan:inn | |
| DEFVIWRASFVYLL-UHFFFAOYSA-N | |
| 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid | |
| 6207 | |
| 380.34 | |
| Crystalline Powder |
Safety and Handling
EINECSNumber : 200-651-2
RUO – Research Use Only