missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Ethylene Glycol Dimethacrylate (stabilized with HQ) 97.0+%, TCI America™
Supplier: TCI America E010225ML
Specifications
| Ethylene Glycol Dimethacrylate (stabilized with HQ) | |
| -40°C | |
| 235°C | |
| MFCD00008590 | |
| ethylene glycol dimethacrylate, ethylene dimethacrylate, glycol dimethacrylate, diglycol dimethacrylate, ethanediol dimethacrylate, ethylenedimethyacrylate, ethylene methacrylate, ethyldiol metacrylate, 1,2-bis methacryloyloxy ethane, ethylene glycol bis methacrylate | |
| CC(=C)C(=O)OCCOC(=O)C(C)=C | |
| 198.22 | |
| CHEBI:53436 | |
| ≥97.0% (GC) |
| 97-90-5 | |
| Colorless | |
| C10H14O4 | |
| 25 mL | |
| STVZJERGLQHEKB-UHFFFAOYSA-N | |
| 2-[(2-methylprop-2-enoyl)oxy]ethyl 2-methylprop-2-enoate | |
| 7355 | |
| 198.22 | |
| Liquid |
Chemical Identifiers
| 97-90-5 | |
| 198.22 | |
| STVZJERGLQHEKB-UHFFFAOYSA-N | |
| 7355 | |
| 2-[(2-methylprop-2-enoyl)oxy]ethyl 2-methylprop-2-enoate |
| C10H14O4 | |
| MFCD00008590 | |
| ethylene glycol dimethacrylate, ethylene dimethacrylate, glycol dimethacrylate, diglycol dimethacrylate, ethanediol dimethacrylate, ethylenedimethyacrylate, ethylene methacrylate, ethyldiol metacrylate, 1,2-bis methacryloyloxy ethane, ethylene glycol bis methacrylate | |
| CHEBI:53436 | |
| CC(=C)C(=O)OCCOC(=O)C(C)=C |
Safety and Handling
EINECSNumber : (2)-1056&(2)-1059
RTECSNumber : OZ4400000
TSCA : Yes