Learn More
Ethylene glycol dimethacrylate, 98%, stab. with 100ppm 4-methoxyphenol
Crosslinking monomer | CAS: 97-90-5 | C10H14O4 | 198.22 g/mol
$52.96 - $916.19
Chemical Identifiers
| CAS | 97-90-5 |
|---|---|
| Molecular Formula | C10H14O4 |
| Molecular Weight (g/mol) | 198.22 |
| MDL Number | MFCD00008590 |
| InChI Key | STVZJERGLQHEKB-UHFFFAOYSA-N |
| Synonym | ethylene glycol dimethacrylate, ethylene dimethacrylate, glycol dimethacrylate, diglycol dimethacrylate, ethanediol dimethacrylate, ethylenedimethyacrylate, ethylene methacrylate, ethyldiol metacrylate, 1,2-bis methacryloyloxy ethane, ethylene glycol bis methacrylate |
| PubChem CID | 7355 |
| ChEBI | CHEBI:53436 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate |
| SMILES | CC(=C)C(=O)OCCOC(=O)C(C)=C |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AA4415118
|
Thermo Scientific Chemicals
04415118 |
50 g |
Each for $52.96
|
|
|||||
|
AA4415130
|
Thermo Scientific Chemicals
04415130 |
250 g |
Each for $127.47
|
|
|||||
|
AA44151A1
|
Thermo Scientific Chemicals
044151A1 |
1 kg |
Each for $448.38
|
|
|||||
|
AA44151A6
|
Thermo Scientific Chemicals
044151A6 |
4 kg |
Each for $916.19
|
|
|||||
Description
Ethylene glycol dimethacrylate is used as a functional monomer for polymers and as a cross linking agent between the molecular chains of polymers and elastomers. It is also used in free radical copolymer cross linking reactions. It acts as an intermediate in the production of hydroxyapatite and poly methyl methacrylate composites.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 97-90-5 | |
| 198.22 | |
| STVZJERGLQHEKB-UHFFFAOYSA-N | |
| 7355 | |
| 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate |
| C10H14O4 | |
| MFCD00008590 | |
| ethylene glycol dimethacrylate, ethylene dimethacrylate, glycol dimethacrylate, diglycol dimethacrylate, ethanediol dimethacrylate, ethylenedimethyacrylate, ethylene methacrylate, ethyldiol metacrylate, 1,2-bis methacryloyloxy ethane, ethylene glycol bis methacrylate | |
| CHEBI:53436 | |
| CC(=C)C(=O)OCCOC(=O)C(C)=C |
Specifications
| 97-90-5 | |
| 1.051 g/mL | |
| >110°C (230°F) | |
| 1.454 | |
| MFCD00008590 | |
| 1776663 | |
| ethylene glycol dimethacrylate, ethylene dimethacrylate, glycol dimethacrylate, diglycol dimethacrylate, ethanediol dimethacrylate, ethylenedimethyacrylate, ethylene methacrylate, ethyldiol metacrylate, 1,2-bis methacryloyloxy ethane, ethylene glycol bis methacrylate | |
| STVZJERGLQHEKB-UHFFFAOYSA-N | |
| 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate | |
| 7355 | |
| 198.21 | |
| Liquid |
| Colorless to Yellow | |
| 83°C to 85°C (1 mmHg) | |
| C10H14O4 | |
| H2C=C(CH3)CO2CH2CH2OCOC(CH3)=CH2 | |
| 50 g | |
| Light sensitive | |
| Soluble in water. | |
| CC(=C)C(=O)OCCOC(=O)C(C)=C | |
| 198.22 | |
| CHEBI:53436 | |
| 98% | |
| Ethylene glycol dimethacrylate, Stabilized with 100ppm 4-methoxyphenol |
Safety and Handling
GHS H Statement
H317-H335
May cause an allergic skin reaction.
May cause respiratory irritation.
P261-P271-P272-P280g-P302+P352-P304+P340-P312-P333+P313-P363-P501c
H317-H335
EINECSNumber : 202-617-2
RTECSNumber : OZ4400000
TSCA : Yes
Recommended Storage : Keep cold
RUO – Research Use Only