missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Ethyl trans-2-amino-4-cyclohexene-1-carboxylate hydrochloride, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 334410010
Description
Specifications
| Ethyl trans-2-amino-4-cyclohexene-1-carboxylate hydrochloride | |
| 142547-16-8 | |
| Beige to White or Gray | |
| 98% | |
| C9H16NO2 | |
| MFCD01863252 | |
| trans-6-amino-cyclohex-3-enecarboxylic acid ethyl ester hydrochloride, trans-ethyl 6-aminocyclohex-3-enecarboxylate hydrochloride, ethyl trans-2-amino-4-cyclohexene-1-carboxylate hydrochloride | |
| PTXUIEXYXGXMEU-HTQZYQBOSA-O | |
| ethyl (1R,6R)-6-aminocyclohex-3-ene-1-carboxylate;hydrochloride | |
| 17039343 | |
| 98% |
| 98% | |
| 107°C to 109°C | |
| Authentic | |
| Glass bottle | |
| C6H8(NH2)COOCH2CH3·HCl | |
| 1 g | |
| Solubility in water: .. Other solubilities: soluble in ethanol | |
| CCOC(=O)[C@@H]1CC=CC[C@H]1[NH3+] | |
| 170.23 | |
| 205.68 | |
| Powder |
Chemical Identifiers
| 142547-16-8 | |
| 170.23 | |
| PTXUIEXYXGXMEU-HTQZYQBOSA-O | |
| 17039343 | |
| CCOC(=O)[C@@H]1CC=CC[C@H]1[NH3+] |
| C9H16NO2 | |
| MFCD01863252 | |
| trans-6-amino-cyclohex-3-enecarboxylic acid ethyl ester hydrochloride, trans-ethyl 6-aminocyclohex-3-enecarboxylate hydrochloride, ethyl trans-2-amino-4-cyclohexene-1-carboxylate hydrochloride | |
| ethyl (1R,6R)-6-aminocyclohex-3-ene-1-carboxylate;hydrochloride |
RUO – Research Use Only