missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Ethyl oleate, 98%, mixture of homologeous fatty acid esters
CAS: 111-62-6 | C20H38O2 | 310.51 g/mol
Supplier: Thermo Scientific Chemicals 410292500
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Ethyl oleate | |
| 0.5mg KOH/g max. | |
| 190.0°C to 210.0°C (7.0 mmHg) | |
| Authentic | |
| Glass bottle | |
| 1.4490 to 1.4530 | |
| 250 g | |
| 0.86 | |
| Solubility in water: insoluble. Other solubilities: soluble in alcohol | |
| CCCCCCCCC=CCCCCCCCC(=O)OCC | |
| 310.51 | |
| CHEBI:84940 | |
| 98% |
| 111-62-6 | |
| 0.8600g/mL | |
| 160°C | |
| 60% min. (oleic acid) (GC) | |
| C20H38O2 | |
| CH3(CH2)7CHCH(CH2)7COOC2H5 | |
| 177 to 188mg KOH/g | |
| ethyl oleate, ethyl cis-9-octadecenoate, oleic acid, ethyl ester, oleic acid ethyl ester, 9-octadecenoic acid z-, ethyl ester, ethyl oleate nf, ethyl z-octadec-9-enoate, ethyl oleate natural, fema no. 2450 | |
| LVGKNOAMLMIIKO-QXMHVHEDSA-N | |
| ethyl (Z)-octadec-9-enoate | |
| 5363269 | |
| 310.51 | |
| Oily Liquid |
Chemical Identifiers
| 111-62-6 | |
| 310.51 | |
| ethyl oleate, ethyl cis-9-octadecenoate, oleic acid, ethyl ester, oleic acid ethyl ester, 9-octadecenoic acid z-, ethyl ester, ethyl oleate nf, ethyl z-octadec-9-enoate, ethyl oleate natural, fema no. 2450 | |
| CHEBI:84940 | |
| CCCCCCCCC=CCCCCCCCC(=O)OCC |
| C20H38O2 | |
| LVGKNOAMLMIIKO-QXMHVHEDSA-N | |
| 5363269 | |
| ethyl (Z)-octadec-9-enoate |
Safety and Handling
EINECSNumber : 203-889-5
RUO – Research Use Only