missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Ethyl oleate, 98%, mixture of homologeous fatty acid esters
CAS: 111-62-6 | C20H38O2 | 310.51 g/mol
$73.97 - $483.02
Chemical Identifiers
| CAS | 111-62-6 |
|---|---|
| Molecular Formula | C20H38O2 |
| Molecular Weight (g/mol) | 310.51 |
| InChI Key | LVGKNOAMLMIIKO-QXMHVHEDSA-N |
| Synonym | ethyl oleate, ethyl cis-9-octadecenoate, oleic acid, ethyl ester, oleic acid ethyl ester, 9-octadecenoic acid z-, ethyl ester, ethyl oleate nf, ethyl z-octadec-9-enoate, ethyl oleate natural, fema no. 2450 |
| PubChem CID | 5363269 |
| ChEBI | CHEBI:84940 |
| IUPAC Name | ethyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC410292500
|
Thermo Scientific Chemicals
410292500 |
250 g | Glass bottle |
Each for $73.97
|
|
||||
|
AC410290010
|
Thermo Scientific Chemicals
410290010 |
1 kg | Glass bottle |
Each for $214.92
|
|
||||
|
AC410290025
|
Thermo Scientific Chemicals
410290025 |
2.5 kg | Plastic bottle |
Each for $483.02
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 111-62-6 | |
| 310.51 | |
| ethyl oleate, ethyl cis-9-octadecenoate, oleic acid, ethyl ester, oleic acid ethyl ester, 9-octadecenoic acid z-, ethyl ester, ethyl oleate nf, ethyl z-octadec-9-enoate, ethyl oleate natural, fema no. 2450 | |
| CHEBI:84940 | |
| CCCCCCCCC=CCCCCCCCC(=O)OCC |
| C20H38O2 | |
| LVGKNOAMLMIIKO-QXMHVHEDSA-N | |
| 5363269 | |
| ethyl (Z)-octadec-9-enoate |
Specifications
| 111-62-6 | |
| 0.8600g/mL | |
| 160°C | |
| 60% min. (oleic acid) (GC) | |
| C20H38O2 | |
| CH3(CH2)7CHCH(CH2)7COOC2H5 | |
| 177 to 188mg KOH/g | |
| ethyl oleate, ethyl cis-9-octadecenoate, oleic acid, ethyl ester, oleic acid ethyl ester, 9-octadecenoic acid z-, ethyl ester, ethyl oleate nf, ethyl z-octadec-9-enoate, ethyl oleate natural, fema no. 2450 | |
| LVGKNOAMLMIIKO-QXMHVHEDSA-N | |
| ethyl (Z)-octadec-9-enoate | |
| 5363269 | |
| 310.51 | |
| Oily Liquid |
| 0.5mg KOH/g max. | |
| 190.0°C to 210.0°C (7.0 mmHg) | |
| Authentic | |
| Glass bottle | |
| 1.4490 to 1.4530 | |
| 250 g | |
| 0.86 | |
| Solubility in water: insoluble. Other solubilities: soluble in alcohol | |
| CCCCCCCCC=CCCCCCCCC(=O)OCC | |
| 310.51 | |
| CHEBI:84940 | |
| 98% | |
| Ethyl oleate |
Safety and Handling
EINECSNumber : 203-889-5
RUO – Research Use Only