missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
MP Biomedicals Inc Ethoxyquin, ≥90%, MP Biomedicals™
Supplier: MP Biomedicals Inc 0215796380
Specifications
| Ethoxyquin | |
| Brown | |
| ≥90% | |
| MFCD00023883 | |
| ethoxyquin, 6-ethoxy-2,2,4-trimethyl-1,2-dihydroquinoline, ethoxyquine, santoquin, santoquine, niflex, antioxidant ec, santoflex a, santoflex aw, stop-scald | |
| CCOC1=CC2=C(C=C1)NC(C=C2C)(C)C | |
| 217.312 | |
| CHEBI:77323 | |
| Viscous Liquid |
| 91-53-2 | |
| 1.030g/mL | |
| C14H19NO | |
| 100 g | |
| DECIPOUIJURFOJ-UHFFFAOYSA-N | |
| 6-ethoxy-2,2,4-trimethyl-1H-quinoline | |
| 3293 | |
| 217.3 |
Chemical Identifiers
| 91-53-2 | |
| 217.312 | |
| DECIPOUIJURFOJ-UHFFFAOYSA-N | |
| 3293 | |
| 6-ethoxy-2,2,4-trimethyl-1H-quinoline |
| C14H19NO | |
| MFCD00023883 | |
| ethoxyquin, 6-ethoxy-2,2,4-trimethyl-1,2-dihydroquinoline, ethoxyquine, santoquin, santoquine, niflex, antioxidant ec, santoflex a, santoflex aw, stop-scald | |
| CHEBI:77323 | |
| CCOC1=CC2=C(C=C1)NC(C=C2C)(C)C |
Safety and Handling
EINECSNumber : 202-075-7
Recommended Storage : Store at Room Temperature (15 to 30°C). Store Desiccated. Store under nitrogen.