Learn More
Ethinylestradiol, 98%, Thermo Scientific Chemicals
Supplier: Thermo Scientific Chemicals 461550050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Ethinylestradiol | |
| 180.0°C to 188.0°C | |
| 97.5% min. (HPLC) | |
| MFCD00003690 | |
| ethinyl estradiol, ethynylestradiol, ethynyl estradiol, ethinylestradiol, ethinyloestradiol, ginestrene, 17-ethinylestradiol, progynon c, ethinoral, eticyclin | |
| C[C@]12CC[C@H]3[C@@H](CCC4=CC(O)=CC=C34)[C@@H]1CC[C@@]2(O)C#C | |
| 296.41 | |
| CHEBI:4903 | |
| 98% |
| 57-63-6 | |
| Authentic | |
| C20H24O2 | |
| 5 g | |
| BFPYWIDHMRZLRN-SLHNCBLASA-N | |
| (8R,9S,13S,14S,17R)-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol | |
| 5991 | |
| 296.41 |
Chemical Identifiers
| 57-63-6 | |
| 296.41 | |
| BFPYWIDHMRZLRN-SLHNCBLASA-N | |
| 5991 | |
| (8R,9S,13S,14S,17R)-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| C20H24O2 | |
| MFCD00003690 | |
| ethinyl estradiol, ethynylestradiol, ethynyl estradiol, ethinylestradiol, ethinyloestradiol, ginestrene, 17-ethinylestradiol, progynon c, ethinoral, eticyclin | |
| CHEBI:4903 | |
| C[C@]12CC[C@H]3[C@@H](CCC4=CC(O)=CC=C34)[C@@H]1CC[C@@]2(O)C#C |
Safety and Handling
GHS H Statement Harmful if swallowed. May cause cancer.
GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Call a POISON CENTER or doctor/physician if you feel unwell. Wash face, hands and any exposed skin thoroughly after handling. Obtain special instructions before use. Wear protective gloves/protective clothing/eye protection/face protection.
GHS Signal Word: Danger
EINECSNumber : 200-342-2
RUO – Research Use Only