Learn More
Ethinylestradiol, 98%, Thermo Scientific Chemicals
$211.27 - $524.62
Chemical Identifiers
| CAS | 57-63-6 |
|---|---|
| Molecular Formula | C20H24O2 |
| Molecular Weight (g/mol) | 296.41 |
| MDL Number | MFCD00003690 |
| InChI Key | BFPYWIDHMRZLRN-SLHNCBLASA-N |
| Synonym | ethinyl estradiol, ethynylestradiol, ethynyl estradiol, ethinylestradiol, ethinyloestradiol, ginestrene, 17-ethinylestradiol, progynon c, ethinoral, eticyclin |
| PubChem CID | 5991 |
| ChEBI | CHEBI:4903 |
| IUPAC Name | (8R,9S,13S,14S,17R)-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=CC(O)=CC=C34)[C@@H]1CC[C@@]2(O)C#C |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC461550010
|
Thermo Scientific Chemicals
461550010 |
1 g |
Each for $211.27
|
|
|||||
|
AC461550050
|
Thermo Scientific Chemicals
461550050 |
5 g |
Each for $524.62
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 57-63-6 | |
| 296.41 | |
| BFPYWIDHMRZLRN-SLHNCBLASA-N | |
| 5991 | |
| (8R,9S,13S,14S,17R)-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| C20H24O2 | |
| MFCD00003690 | |
| ethinyl estradiol, ethynylestradiol, ethynyl estradiol, ethinylestradiol, ethinyloestradiol, ginestrene, 17-ethinylestradiol, progynon c, ethinoral, eticyclin | |
| CHEBI:4903 | |
| C[C@]12CC[C@H]3[C@@H](CCC4=CC(O)=CC=C34)[C@@H]1CC[C@@]2(O)C#C |
Specifications
| 57-63-6 | |
| Authentic | |
| Glass Bottle | |
| MFCD00003690 | |
| ethinyl estradiol, ethynylestradiol, ethynyl estradiol, ethinylestradiol, ethinyloestradiol, ginestrene, 17-ethinylestradiol, progynon c, ethinoral, eticyclin | |
| C[C@]12CC[C@H]3[C@@H](CCC4=CC(O)=CC=C34)[C@@H]1CC[C@@]2(O)C#C | |
| 296.41 | |
| CHEBI:4903 | |
| 98% |
| 180.0°C to 188.0°C | |
| 97.5% min. (HPLC) | |
| C20H24O2 | |
| 1 g | |
| BFPYWIDHMRZLRN-SLHNCBLASA-N | |
| (8R,9S,13S,14S,17R)-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol | |
| 5991 | |
| 296.41 | |
| Ethinylestradiol |
Safety and Handling
GHS H Statement Harmful if swallowed. May cause cancer.
GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Call a POISON CENTER or doctor/physician if you feel unwell. Wash face, hands and any exposed skin thoroughly after handling. Obtain special instructions before use. Wear protective gloves/protective clothing/eye protection/face protection.
GHS Signal Word: Danger
EINECSNumber : 200-342-2
RUO – Research Use Only