Learn More
Eriochrome™ Black T, ACS Grade, LabChem™
Supplier: LabChem LC140358
Specifications
| Eriochrome™ Black T | |
| 100 | |
| C20H12N3O7NaS | |
| Soluble in water | |
| JHUJLRKQZAPSDP-GXTSIBQPSA-M | |
| sodium (4Z)-4-[2-(1-hydroxynaphthalen-2-yl)hydrazin-1-ylidene]-7-nitro-3-oxo-3,4-dihydronaphthalene-1-sulfonate | |
| 87355429 | |
| ACS | |
| Passes Test | |
| Black | |
| Powder |
| 1787-61-7 | |
| C20H12N3NaO7S | |
| MFCD00003935 | |
| Passes Test | |
| [Na+].OC1=C2C=CC=CC2=CC=C1N\N=C1/C(=O)C=C(C2=CC(=CC=C12)[N+]([O-])=O)S([O-])(=O)=O | |
| 461.38 | |
| 461.38 | |
| Amber Glass | |
| Nitrogen oxides; Sulfur compounds; Carbon monoxide; Carbon dioxide | |
| 25 g |
Chemical Identifiers
| 1787-61-7 | |
| 461.38 | |
| JHUJLRKQZAPSDP-GXTSIBQPSA-M | |
| sodium (4Z)-4-[2-(1-hydroxynaphthalen-2-yl)hydrazin-1-ylidene]-7-nitro-3-oxo-3,4-dihydronaphthalene-1-sulfonate |
| C20H12N3NaO7S | |
| MFCD00003935 | |
| 87355429 | |
| [Na+].OC1=C2C=CC=CC2=CC=C1N\N=C1/C(=O)C=C(C2=CC(=CC=C12)[N+]([O-])=O)S([O-])(=O)=O |
Safety and Handling
GHS H Statement
Causes serious eye irritation.
Harmful to aquatic life with long lasting effects.
GHS P Statement
Wear protective gloves, eye protection.
Wash exposed skin thoroughly after handling.
Avoid release to the environment.
If in eyes: Rinse cautiously with water for several minutes.
Remove contact lenses, if present and easy to do.
Continue rinsing.
If eye irritation persists: Get medical advice/attention.
Dispose of contents/container to comply with local, state and federal regulations.
Warning
EINECSNumber : 217-250-3
Recommended Storage : Room Temperature