Learn More
Eosin Y, Reagent, ACS, Spectrum™ Chemical
E1295, 17372-87-1, C20H6Br4Na2O5
Supplier: Spectrum Chemical Mfg Cor E129525GM
Description
Spectrum™ Chemical Eosin Y, Reagent, ACS , a form of eosin, is used as an acidic red stain for indicating cytoplasm material. As an ACS grade quality reagent, its chemical specifications are the de facto standards for chemicals used in many high-purity applications and typically designate the highest quality chemical available for laboratory use. Spectrum Chemical manufactured Reagent ACS grade products meet the toughest regulatory standards for quality and purity.
Specifications
| Crystalline Powder | |
| 17372-87-1 | |
| Amber Glass Bottle | |
| 25 g | |
| SEACYXSIPDVVMV-UHFFFAOYSA-L | |
| disodium 2-(2,4,5,7-tetrabromo-6-oxido-3-oxo-3H-xanthen-9-yl)benzoate | |
| ACS |
| Eosin Y | |
| 100% | |
| Red to Brown | |
| C20H6Br4Na2O5 | |
| [Na+].[Na+].[O-]C(=O)C1=CC=CC=C1C1=C2C=C(Br)C(=O)C(Br)=C2OC2=C(Br)C([O-])=C(Br)C=C12 | |
| 691.86 |
Chemical Identifiers
| 17372-87-1 | |
| 691.86 | |
| disodium 2-(2,4,5,7-tetrabromo-6-oxido-3-oxo-3H-xanthen-9-yl)benzoate |
| C20H6Br4Na2O5 | |
| SEACYXSIPDVVMV-UHFFFAOYSA-L | |
| [Na+].[Na+].[O-]C(=O)C1=CC=CC=C1C1=C2C=C(Br)C(=O)C(Br)=C2OC2=C(Br)C([O-])=C(Br)C=C12 |