missing translation for 'onlineSavingsMsg'
Learn More
Learn More
MilliporeSigma™ EDTA, OmniPur™, Calbiochem™,
Supplier: MilliporeSigma™ 4005500GM
Specifications
| EDTA | |
| 239.85°C | |
| 2.5 to 3.5 (aq. soln.) | |
| C10H16N2O8 | |
| 500 g | |
| Partially soluble in water | |
| OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O | |
| 292.24 | |
| CHEBI:42191 | |
| ≥99.5% |
| 60-00-4 | |
| White | |
| Molecular biology grade | |
| MFCD00003541 | |
| edta, edetic acid, ethylenediaminetetraacetic acid, edathamil, versene, endrate, havidote, titriplex, edta acid, sequestrol | |
| KCXVZYZYPLLWCC-UHFFFAOYSA-N | |
| 2-({2-[bis(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetic acid | |
| 6049 | |
| 292.3 | |
| Solid |
Chemical Identifiers
| 60-00-4 | |
| 292.24 | |
| KCXVZYZYPLLWCC-UHFFFAOYSA-N | |
| 6049 | |
| 2-({2-[bis(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetic acid |
| C10H16N2O8 | |
| MFCD00003541 | |
| edta, edetic acid, ethylenediaminetetraacetic acid, edathamil, versene, endrate, havidote, titriplex, edta acid, sequestrol | |
| CHEBI:42191 | |
| OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
Safety and Handling
Recommended Storage : Store in accordance with local regulations. Store in original container, protected from direct sunlight. Keep container tightly closed and sealed until ready for use.