missing translation for 'onlineSavingsMsg'
Learn More
Learn More
EDTA disodium salt solution, Volumetric, Reag. Ph. Eur., 0.1Â M EDTA-Na2, for complexometry, Honeywell Fluka™
Volumetric, Reag. Ph. Eur., 0.1Â M EDTA-Na2, for complexometry
Supplier: Honeywell-Fluka 345506X1L
Description
Honeywell´s high-quality titration products cover the complete titration workflow and include:
- Solutions for volumetric titration (acids, bases, or salts)
- Buffers available as concentrates or ready-to-use
- Reagents for complexometry:
- Aminopolycarboxylic acids (EDTA/NTA analogs)
- Masking agents
- Indicators for volumetric and complexometric titrations
Specifications
| EDTA disodium salt solution | |
| 139-33-3,7732-18-5 | |
| ≤100.0000% | |
| [-CH2N(CH2CO2Na)CH2CO2H]2 | |
| 3822669 | |
| 1.01 g/cm3 | |
| ZGTMUACCHSMWAC-UHFFFAOYSA-L | |
| disodium;2-[2-[bis(carboxylatomethyl)azaniumyl]ethyl-(carboxylatomethyl)azaniumyl]acetate | |
| 57339238 | |
| 372.24 | |
| Poly Bottle |
| Volumetric, Reag. Ph. Eur., 0.1Â M EDTA-Na2, for complexometry | |
| ≥90.0000% | |
| C10H14N2Na2O8 | |
| MFCD00070672,MFCD00003541,MFCD00070672,MFCD00150037 | |
| 0.1Â M EDTA-Na2 | |
| ethylenediaminetetraacetic acid disodium salt, edta na2, disodium 2-2-bis carboxymethyl amino ethyl-carboxymethyl amino acetic acid | |
| [Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O | |
| 336.21 | |
| CHEBI:64734 | |
| Reagent Ph. Eur. | |
| 6 x 1 L |