missing translation for 'onlineSavingsMsg'
Learn More
Learn More
EDTA disodium salt concentrate, For 1L standard solution, 0.1Â M EDTA-Na2, for complexometry, Honeywell Fluka™
for 1L standard solution, 0.1Â M EDTA-Na2, for complexometry
Supplier: Honeywell Chemicals 380576X1EA
Description
- Leading the Industry For Over 65 Years
- Honeywell now delivers Fluka™ premium grade inorganic reagents worldwide – with consistency, purity, and accuracy assured
Specifications
| EDTA disodium salt concentrate | |
| 139-33-3,7732-18-5 | |
| <30.0000%,<85.0000% | |
| 6 x 1 Ea. | |
| [-CH2N(CH2CO2Na)CH2CO2H]2 | |
| UN3265 | |
| ethylenediaminetetraacetic acid disodium salt, edta na2, disodium 2-2-bis carboxymethyl amino ethyl-carboxymethyl amino acetic acid, EDTA-Na2 | |
| [Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O | |
| 336.21 | |
| CHEBI:64734 | |
| Ampoule |
| For 1L standard solution, 0.1Â M EDTA-Na2, for complexometry | |
| >15.0000%,>70.0000% | |
| Concentrate | |
| C10H14N2Na2O8 | |
| MFCD00070672,MFCD00003541,MFCD00070672,MFCD00150037 | |
| 3822669 | |
| ZGTMUACCHSMWAC-UHFFFAOYSA-L | |
| disodium;2-[2-[bis(carboxylatomethyl)azaniumyl]ethyl-(carboxylatomethyl)azaniumyl]acetate | |
| 57339238 | |
| 336.21 |
Chemical Identifiers
| 139-33-3 | |
| 336.21 | |
| ZGTMUACCHSMWAC-UHFFFAOYSA-L | |
| CHEBI:64734 | |
| [Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| C10H14N2Na2O8 | |
| MFCD00070672,MFCD00003541,MFCD00070672,MFCD00150037 | |
| 57339238 | |
| disodium;2-[2-[bis(carboxylatomethyl)azaniumyl]ethyl-(carboxylatomethyl)azaniumyl]acetate |
Safety and Handling
P280-P303 + P361 + P353-P304 + P340 + P310-P305 + P351 + P338
ShelfLife : 1260 days from date of manufacture
DOTInformation : 8 / PGII
Recommended Storage : Room Temp