Learn More
Donepezil hydrochloride
CAS: 120011-70-3 | C24H30ClNO3 | 415.96 g/mol
$174.98 - $603.69
Chemical Identifiers
| CAS | 120011-70-3 |
|---|---|
| Molecular Formula | C24H30ClNO3 |
| Molecular Weight (g/mol) | 415.96 |
| MDL Number | MFCD00881312 |
| InChI Key | XWAIAVWHZJNZQQ-UHFFFAOYNA-N |
| Synonym | donepezil hydrochloride, donepezil hcl, aricept, bnag, donepezilhcl, aricept odt, 2-1-benzylpiperidin-4-yl methyl-5,6-dimethoxy-2,3-dihydro-1h-inden-1-one hydrochloride, e 2020 pharmaceutical, eranz |
| PubChem CID | 5741 |
| ChEBI | CHEBI:4696 |
| IUPAC Name | 2-[(1-benzylpiperidin-4-yl)methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one;hydrochloride |
| SMILES | [H+].[Cl-].COC1=CC2=C(C=C1OC)C(=O)C(CC1CCN(CC3=CC=CC=C3)CC1)C2 |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC458050010
|
Thermo Scientific Chemicals
458050010 |
1 g |
Each for $174.98
|
|
|||||
|
AC458050050
|
Thermo Scientific Chemicals
458050050 |
5 g |
Each for $603.69
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 120011-70-3 | |
| 415.96 | |
| XWAIAVWHZJNZQQ-UHFFFAOYNA-N | |
| 5741 | |
| 2-[(1-benzylpiperidin-4-yl)methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one;hydrochloride |
| C24H30ClNO3 | |
| MFCD00881312 | |
| donepezil hydrochloride, donepezil hcl, aricept, bnag, donepezilhcl, aricept odt, 2-1-benzylpiperidin-4-yl methyl-5,6-dimethoxy-2,3-dihydro-1h-inden-1-one hydrochloride, e 2020 pharmaceutical, eranz | |
| CHEBI:4696 | |
| [H+].[Cl-].COC1=CC2=C(C=C1OC)C(=O)C(CC1CCN(CC3=CC=CC=C3)CC1)C2 |
Specifications
| 120011-70-3 | |
| Authentic | |
| MFCD00881312 | |
| donepezil hydrochloride, donepezil hcl, aricept, bnag, donepezilhcl, aricept odt, 2-1-benzylpiperidin-4-yl methyl-5,6-dimethoxy-2,3-dihydro-1h-inden-1-one hydrochloride, e 2020 pharmaceutical, eranz | |
| XWAIAVWHZJNZQQ-UHFFFAOYNA-N | |
| 2-[(1-benzylpiperidin-4-yl)methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one;hydrochloride | |
| 5741 | |
| 415.85 | |
| Donepezil hydrochloride |
| 211.0°C to 212.0°C | |
| C24H30ClNO3 | |
| 1 g | |
| Solubility in water: soluble. Other solubilities: soluble in hot methanol, insoluble in ethyl acetate and hexane | |
| [H+].[Cl-].COC1=CC2=C(C=C1OC)C(=O)C(CC1CCN(CC3=CC=CC=C3)CC1)C2 | |
| 415.96 | |
| CHEBI:4696 | |
| ≥97.5% (HPLC) |
Safety and Handling
GHS H Statement
Toxic if swallowed.
Causes serious eye irritation.
GHS P Statement
Wash face,hands and any exposed skin thoroughly after handling.
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
Wear eye protection/face protection.
If eye irritation persists: Get medical advice/
GHS Signal Word: Danger
RUO – Research Use Only