Learn More
Dodecanedioyl dichloride, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 305340250
| Quantity | 25g |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| C12H20Cl2O2 | |
| MFCD00012243 | |
| dodecanedioyldichloride, dodecandioyldichloride, dodecanedioyl chloride, acmc-209kct, dodecanedioic acid dichloride, 1,12-dodecanedioyl dichloride, dodecanedioyl dichloride | |
| dodecanedioyl dichloride |
Specifications
| Dodecanedioyl dichloride | |
| 4834-98-4 | |
| 140°C (0.5mmHg) | |
| Authentic | |
| Glass bottle | |
| 1.4670 to 1.469 | |
| 25g | |
| 1.06 | |
| CNXXEPWXNDFGIG-UHFFFAOYSA-N | |
| dodecanedioyl dichloride | |
| 2733242 | |
| 98% |
| 98% | |
| 1.0600g/mL | |
| >110°C | |
| 97.5% min. (GC) | |
| C12H20Cl2O2 | |
| ClCO(CH2)10COCl | |
| MFCD00012243 | |
| dodecanedioyldichloride, dodecandioyldichloride, dodecanedioyl chloride, acmc-209kct, dodecanedioic acid dichloride, 1,12-dodecanedioyl dichloride, dodecanedioyl dichloride | |
| C(CCCCCC(=O)Cl)CCCCC(=O)Cl | |
| 267.2 | |
| 267.2 |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
Immediately call a POISON CENTER or doctor/physician.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if pre
GHS Signal Word: Danger
Recommended Storage : Product may darken during storage