missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals DL-Tryptophan, 98%
CAS: 54-12-6 | C11H12N2O2 | 204.23 g/mol
Supplier: Thermo Scientific Chemicals 172110250
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| DL-Tryptophan | |
| 54-12-6 | |
| Authentic | |
| 98% | |
| C11H12N2O2 | |
| MFCD00064339 | |
| dl-tryptophan, 2-amino-3-1h-indol-3-yl propanoic acid, racemic tryptophan, dl-trytophane, dl-trytophan, +--tryptophan, h-dl-trp-oh, dl-3beta-indolylalanine, dl-tryptophane, tryptophan . | |
| NC(CC1=CNC2=CC=CC=C12)C(O)=O | |
| 25 g | |
| 1148 | |
| 204.23 | |
| Crystalline Powder |
| 99% | |
| Beige to White or Yellow | |
| 0.8% max. (105°C, 3 hrs) (vacuum) | |
| (TLC) Not detected | |
| Plastic Bottle | |
| 22, 550 | |
| QIVBCDIJIAJPQS-UHFFFAOYSA-N | |
| 2-amino-3-(1H-indol-3-yl)propanoic acid | |
| 204.23 | |
| CHEBI:27897 | |
| ≥97.5% |
Chemical Identifiers
| 54-12-6 | |
| 204.23 | |
| QIVBCDIJIAJPQS-UHFFFAOYSA-N | |
| 1148 | |
| 2-amino-3-(1H-indol-3-yl)propanoic acid |
| C11H12N2O2 | |
| MFCD00064339 | |
| dl-tryptophan, 2-amino-3-1h-indol-3-yl propanoic acid, racemic tryptophan, dl-trytophane, dl-trytophan, +--tryptophan, h-dl-trp-oh, dl-3beta-indolylalanine, dl-tryptophane, tryptophan . | |
| CHEBI:27897 | |
| NC(CC1=CNC2=CC=CC=C12)C(O)=O |
RUO – Research Use Only