Learn More
DL-1,4-Dithiothreitol, For Biochemistry, 1M solution in water, ACROS Organics™
$45.37 - $658.75
Chemical Identifiers
| CAS | 3496-11-5 |
|---|---|
| Molecular Formula | C17H20N2O6 |
| Molecular Weight (g/mol) | 348.36 |
| MDL Number | MFCD00004877 |
| InChI Key | MFAOBGXYLNLLJE-UHFFFAOYNA-N |
| Synonym | 2,5-dioxopyrrolidin-1-yl 2s-2-benzyloxy carbonyl amino-3-methylbutanoate, benzyl s-1-2,5-dioxo-1-pyrrolidinyl oxy carbonyl-2-methylpropyl carbamate, cbz-val-osu, ksc496o1j, l-valine,n-phenylmethoxy carbonyl-, 2,5-dioxo-1-pyrrolidinyl ester, n-cbz-l-valine succinimidyl ester, n-cbz-valinyl oxy-succinimide, s-2,5-dioxopyrrolidin-1-yl 2-benzyloxy carbonyl amino-3-methylbutanoate, z-val-osu, zvalosu |
| PubChem CID | 853556 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CC(C)C(C(=O)ON1C(=O)CCC1=O)NC(=O)OCC2=CC=CC=C2 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
| AC426380100 SDS |
Thermo Fisher Scientific
AC426380100 |
10mL | Glass bottle |
Each for $45.37
|
|
AC426380500 SDS |
Thermo Fisher Scientific
AC426380500 |
50mL | Glass bottle |
Each for $134.26
|
|
AC426382500 SDS |
Thermo Fisher Scientific
AC426382500 |
250mL | Glass bottle |
Each for $658.75
|
|
Description
For biochemistryChemical Identifiers
| 3496-11-5 | |
| 348.36 | |
| MFAOBGXYLNLLJE-UHFFFAOYNA-N | |
| 853556 | |
| CC(C)C(C(=O)ON1C(=O)CCC1=O)NC(=O)OCC2=CC=CC=C2 |
| C17H20N2O6 | |
| MFCD00004877 | |
| 2,5-dioxopyrrolidin-1-yl 2s-2-benzyloxy carbonyl amino-3-methylbutanoate, benzyl s-1-2,5-dioxo-1-pyrrolidinyl oxy carbonyl-2-methylpropyl carbamate, cbz-val-osu, ksc496o1j, l-valine,n-phenylmethoxy carbonyl-, 2,5-dioxo-1-pyrrolidinyl ester, n-cbz-l-valine succinimidyl ester, n-cbz-valinyl oxy-succinimide, s-2,5-dioxopyrrolidin-1-yl 2-benzyloxy carbonyl amino-3-methylbutanoate, z-val-osu, zvalosu | |
| (2,5-dioxopyrrolidin-1-yl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
Specifications
| 3496-11-5,7732-18-5 | |
| MFCD00004877 | |
| 1.0400g/mL | |
| 2,5-dioxopyrrolidin-1-yl 2s-2-benzyloxy carbonyl amino-3-methylbutanoate, benzyl s-1-2,5-dioxo-1-pyrrolidinyl oxy carbonyl-2-methylpropyl carbamate, cbz-val-osu, ksc496o1j, l-valine,n-phenylmethoxy carbonyl-, 2,5-dioxo-1-pyrrolidinyl ester, n-cbz-l-valine succinimidyl ester, n-cbz-valinyl oxy-succinimide, s-2,5-dioxopyrrolidin-1-yl 2-benzyloxy carbonyl amino-3-methylbutanoate, z-val-osu, zvalosu | |
| CC(C)C(C(=O)ON1C(=O)CCC1=O)NC(=O)OCC2=CC=CC=C2 | |
| 348.36 | |
| 154.24 | |
| Biochemical | |
| 1.04 | |
| 10mL |
| C17H20N2O6 | |
| 0.90 to 1.10M | |
| 15, 3419 | |
| MFAOBGXYLNLLJE-UHFFFAOYNA-N | |
| (2,5-dioxopyrrolidin-1-yl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate | |
| 853556 | |
| Liquid | |
| Glass bottle | |
| Colorless | |
| DL-1, 4-Dithiothreitol, 1M Solution in water, For molecular biology |
Safety and Handling
GHS H Statement:
Causes serious eye irritation.
Causes skin irritation.
GHS P Statement:
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.
WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification.
GHS Signal Word: Warning