missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Diphenylphosphine oxide, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 310120010
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Diphenylphosphine oxide | |
| Authentic | |
| Glass bottle | |
| (C6H5)2P(O)H | |
| MFCD00002079 | |
| diphenylphosphine oxide, phosphine oxide, diphenyl, diphenyl phosphine oxide, hpoph2, asuollhgalprfk-uhfffaoysa-n, dppo, diphenylphosphane oxide, phenylphosphonoylbenzene, diphenylphosphino-1-one, pubchem23810 | |
| C1=CC=C(C=C1)[P+](=O)C2=CC=CC=C2 | |
| 202.2 | |
| 202.2 |
| 4559-70-0 | |
| 96% min. (GC) | |
| C12H11OP | |
| 1.6080 to 1.6100 | |
| 1g | |
| YFPJFKYCVYXDJK-UHFFFAOYSA-N | |
| oxo(diphenyl)phosphanium | |
| 6327869 | |
| 97% |
Chemical Identifiers
| 4559-70-0 | |
| 202.2 | |
| YFPJFKYCVYXDJK-UHFFFAOYSA-N | |
| 6327869 | |
| C1=CC=C(C=C1)[P+](=O)C2=CC=CC=C2 |
| C12H11OP | |
| MFCD00002079 | |
| diphenylphosphine oxide, phosphine oxide, diphenyl, diphenyl phosphine oxide, hpoph2, asuollhgalprfk-uhfffaoysa-n, dppo, diphenylphosphane oxide, phenylphosphonoylbenzene, diphenylphosphino-1-one, pubchem23810 | |
| oxo(diphenyl)phosphanium |
RUO â Research Use Only