Learn More
Diphenylcarbamyl chloride, 98%
CAS: 83-01-2 | C13H10ClNO | 231.68 g/mol
Supplier: Thermo Scientific Chemicals 167141000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 81.0°C to 85.0°C | |
| 83-01-2 | |
| Authentic | |
| C13H10ClNO | |
| (C6H5)2NCOCl | |
| 15, 3351 | |
| Solubility in water: reacts. | |
| C1=CC=C(C=C1)N(C2=CC=CC=C2)C(=O)Cl | |
| 231.68 | |
| 65741 | |
| 98% |
| Diphenylcarbamyl chloride | |
| Beige to Gray-Green | |
| 97.5% min. (GC) | |
| Glass Bottle | |
| MFCD00000633 | |
| diphenylcarbamyl chloride, diphenylcarbamoyl chloride, carbamic chloride, diphenyl, diphenylcarbamic chloride, n,n-diphenylcarbamyl chloride, diphenylchloroformamide, carbamoyl chloride, diphenyl, carabamic chloride, diphenyl, chloroformic acid diphenylamide, carbamic chloride, n,n-diphenyl | |
| XNBKKRFABABBPM-UHFFFAOYSA-N | |
| N,N-diphenylcarbamoyl chloride | |
| 100 g | |
| 231.68 | |
| Crystalline Powder |
Chemical Identifiers
| 83-01-2 | |
| 231.68 | |
| XNBKKRFABABBPM-UHFFFAOYSA-N | |
| 65741 | |
| C1=CC=C(C=C1)N(C2=CC=CC=C2)C(=O)Cl |
| C13H10ClNO | |
| MFCD00000633 | |
| diphenylcarbamyl chloride, diphenylcarbamoyl chloride, carbamic chloride, diphenyl, diphenylcarbamic chloride, n,n-diphenylcarbamyl chloride, diphenylchloroformamide, carbamoyl chloride, diphenyl, carabamic chloride, diphenyl, chloroformic acid diphenylamide, carbamic chloride, n,n-diphenyl | |
| N,N-diphenylcarbamoyl chloride |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsing.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES:
GHS Signal Word: Danger
EINECSNumber : 201-450-2
RUO – Research Use Only