missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Diphenylcarbamyl chloride, 98%, ACROS Organics™
$83.65 - $207.59
Chemical Identifiers
| CAS | 83-01-2 |
|---|---|
| Molecular Formula | C13H10ClNO |
| Molecular Weight (g/mol) | 231.68 |
| MDL Number | MFCD00000633 |
| InChI Key | XNBKKRFABABBPM-UHFFFAOYSA-N |
| Synonym | carabamic chloride, diphenyl, carbamic chloride, diphenyl, carbamic chloride, n,n-diphenyl, carbamoyl chloride, diphenyl, chloroformic acid diphenylamide, diphenylcarbamic chloride, diphenylcarbamoyl chloride, diphenylcarbamyl chloride, diphenylchloroformamide, n,n-diphenylcarbamyl chloride |
| PubChem CID | 65741 |
| IUPAC Name | N,N-diphenylcarbamoyl chloride |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C(=O)Cl |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC167140250
|
Thermo Fisher Scientific
167140250 |
25g | Glass bottle |
Each for $83.65
|
|
AC167141000
|
Thermo Fisher Scientific
167141000 |
100g | Glass bottle |
Each for $207.59
|
|
AC167145000
|
Thermo Fisher Scientific
AC167145000 |
500g | Glass bottle |
N/A
|
N/A |
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 83-01-2 | |
| 231.68 | |
| XNBKKRFABABBPM-UHFFFAOYSA-N | |
| 65741 | |
| C1=CC=C(C=C1)N(C2=CC=CC=C2)C(=O)Cl |
| C13H10ClNO | |
| MFCD00000633 | |
| carabamic chloride, diphenyl, carbamic chloride, diphenyl, carbamic chloride, n,n-diphenyl, carbamoyl chloride, diphenyl, chloroformic acid diphenylamide, diphenylcarbamic chloride, diphenylcarbamoyl chloride, diphenylcarbamyl chloride, diphenylchloroformamide, n,n-diphenylcarbamyl chloride | |
| N,N-diphenylcarbamoyl chloride |
Specifications
| Authentic | |
| Beige to Gray-Green | |
| 25g | |
| 97.5% min. (GC) | |
| (C6H5)2NCOCl | |
| 15, 3351 | |
| Solubility in water: reacts. | |
| C1=CC=C(C=C1)N(C2=CC=CC=C2)C(=O)Cl | |
| 231.68 | |
| 231.68 | |
| 98% |
| Glass bottle | |
| 81.0°C to 85.0°C | |
| 83-01-2 | |
| C13H10ClNO | |
| MFCD00000633 | |
| carabamic chloride, diphenyl, carbamic chloride, diphenyl, carbamic chloride, n,n-diphenyl, carbamoyl chloride, diphenyl, chloroformic acid diphenylamide, diphenylcarbamic chloride, diphenylcarbamoyl chloride, diphenylcarbamyl chloride, diphenylchloroformamide, n,n-diphenylcarbamyl chloride | |
| XNBKKRFABABBPM-UHFFFAOYSA-N | |
| N,N-diphenylcarbamoyl chloride | |
| 65741 | |
| Crystalline Powder | |
| Diphenylcarbamyl chloride |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsing.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES:
GHS Signal Word: Danger
EINECSNumber : 201-450-2