missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Diphenylacetonitrile, MP Biomedicals™
Used in synthesis of methadone, antispasmodics and other pharmaceuticals
Supplier: MP Biomedicals Inc 0215097080
Specifications
| Diphenylacetonitrile | |
| C14H11N | |
| diphenylacetonitrile, dipan, diphenatrile, benzhydrylcyanide, diphenylmethylcyanide, benzyhydrylcyanide, acetonitrile, diphenyl, benzeneacetonitrile, alpha-phenyl, usaf kf-13, difenylacetonitril | |
| C1=CC=C(C=C1)C(C#N)C2=CC=CC=C2 | |
| 193.249 | |
| 193.2 |
| 86-29-3 | |
| 100 g | |
| NEBPTMCRLHKPOB-UHFFFAOYSA-N | |
| 2,2-diphenylacetonitrile | |
| 6837 | |
| Powder |
Chemical Identifiers
| 86-29-3 | |
| 193.249 | |
| diphenylacetonitrile, dipan, diphenatrile, benzhydrylcyanide, diphenylmethylcyanide, benzyhydrylcyanide, acetonitrile, diphenyl, benzeneacetonitrile, alpha-phenyl, usaf kf-13, difenylacetonitril | |
| 2,2-diphenylacetonitrile |
| C14H11N | |
| NEBPTMCRLHKPOB-UHFFFAOYSA-N | |
| 6837 | |
| C1=CC=C(C=C1)C(C#N)C2=CC=CC=C2 |