Learn More
Diphenyl phthalate, 98%
CAS: 84-62-8 | C20H14O4 | 318.33 g/mol
Supplier: Thermo Scientific Chemicals A1444914
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Diphenyl phthalate | |
| 74°C to 76°C | |
| 400°C to 405°C | |
| Odorless | |
| MFCD00003038 | |
| 2473390 | |
| diphenyl phthalate, phenyl phthalate, phthalic acid, diphenyl ester, diphenylphthalate, 1,2-benzenedicarboxylic acid, diphenyl ester, phthalic acid diphenyl ester, caswell no. 399b, unii-bu20109xhv, 1,2-benzenedicarboxylic acid, 1,2-diphenyl ester, epa pesticide chemical code 017001 | |
| O=C(OC1=CC=CC=C1)C1=CC=CC=C1C(=O)OC1=CC=CC=C1 | |
| 318.33 | |
| CHEBI:60819 | |
| 98% |
| 84-62-8 | |
| 1.28 | |
| 224°C (435°F) | |
| C20H14O4 | |
| 25 g | |
| 14,7306 | |
| DWNAQMUDCDVSLT-UHFFFAOYSA-N | |
| diphenyl benzene-1,2-dicarboxylate | |
| 6778 | |
| 318.33 |
Chemical Identifiers
| 84-62-8 | |
| 318.33 | |
| DWNAQMUDCDVSLT-UHFFFAOYSA-N | |
| 6778 | |
| diphenyl benzene-1,2-dicarboxylate |
| C20H14O4 | |
| MFCD00003038 | |
| diphenyl phthalate, phenyl phthalate, phthalic acid, diphenyl ester, diphenylphthalate, 1,2-benzenedicarboxylic acid, diphenyl ester, phthalic acid diphenyl ester, caswell no. 399b, unii-bu20109xhv, 1,2-benzenedicarboxylic acid, 1,2-diphenyl ester, epa pesticide chemical code 017001 | |
| CHEBI:60819 | |
| O=C(OC1=CC=CC=C1)C1=CC=CC=C1C(=O)OC1=CC=CC=C1 |
Safety and Handling
P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P332+P313-P362-P501c
H315-H319-H335
EINECSNumber : 201-546-4
RTECSNumber : TI1935000
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only