missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Diphenyl carbonate, 99%
CAS: 102-09-0 | C13H10O3 | 214.22 g/mol
$47.88 - $47.88
Chemical Identifiers
| CAS | 102-09-0 |
|---|---|
| Molecular Formula | C13H10O3 |
| Molecular Weight (g/mol) | 214.22 |
| InChI Key | ROORDVPLFPIABK-UHFFFAOYSA-N |
| Synonym | carbonic acid, diphenyl ester, phenyl carbonate, diphenylcarbonate, carbonic acid diphenyl ester, phenyl carbonate pho 2co, unii-ywv401idyn, ph2co3, pho 2co, ywv401idyn, phenyl phenoxyformate |
| PubChem CID | 7597 |
| ChEBI | CHEBI:34722 |
| IUPAC Name | diphenyl carbonate |
| SMILES | C1=CC=C(C=C1)OC(=O)OC2=CC=CC=C2 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC117231000
|
Thermo Scientific Chemicals
117231000 |
100 g | Plastic bottle |
Each for $47.88
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 102-09-0 | |
| 214.22 | |
| carbonic acid, diphenyl ester, phenyl carbonate, diphenylcarbonate, carbonic acid diphenyl ester, phenyl carbonate pho 2co, unii-ywv401idyn, ph2co3, pho 2co, ywv401idyn, phenyl phenoxyformate | |
| CHEBI:34722 | |
| C1=CC=C(C=C1)OC(=O)OC2=CC=CC=C2 |
| C13H10O3 | |
| ROORDVPLFPIABK-UHFFFAOYSA-N | |
| 7597 | |
| diphenyl carbonate |
Specifications
| 102-09-0 | |
| White | |
| 168°C | |
| 98.5% min. (GC) | |
| C13H10O3 | |
| 100 g | |
| 15,3354 | |
| Solubility in water: insoluble. Other solubilities: solulbe in acetone, hot alcohol, benzene, carbon, tetrachloride, ether, glacial acetic acid and, other organic solvents | |
| C1=CC=C(C=C1)OC(=O)OC2=CC=CC=C2 | |
| 214.22 | |
| CHEBI:34722 | |
| 99% | |
| Diphenyl carbonate |
| 78.0°C to 81.0°C | |
| 301.0°C to 302.0°C | |
| Authentic | |
| Plastic bottle | |
| (C6H5O)2CO | |
| 06,158 | |
| carbonic acid, diphenyl ester, phenyl carbonate, diphenylcarbonate, carbonic acid diphenyl ester, phenyl carbonate pho 2co, unii-ywv401idyn, ph2co3, pho 2co, ywv401idyn, phenyl phenoxyformate | |
| ROORDVPLFPIABK-UHFFFAOYSA-N | |
| diphenyl carbonate | |
| 7597 | |
| 214.22 | |
| Crystalline Powder or Flakes |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Toxic to aquatic life with long lasting effects.
GHS P Statement
Wear protective gloves/protective clothing.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
Avoid release to the environment.
GHS Signal Word: Warning
EINECSNumber : 203-005-8
RUO – Research Use Only