missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Dipentyl phthalate, 97%
CAS: 131-18-0 | C18H26O4 | 306.4 g/mol
Supplier: Thermo Scientific Chemicals 357361000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Dipentyl phthalate | |
| -55.0°C | |
| 1.0230g/mL | |
| Authentic | |
| Glass bottle | |
| 1.4885 to 1.4905 | |
| 100 g | |
| dipentyl phthalate, di-n-pentyl phthalate, diamyl phthalate, amyl phthalate, amoil, di-n-amyl phthalate, di-n-pentylphthalate, phthalic acid, dipentyl ester, phthalic acid diamyl ester, 1,2-benzenedicarboxylic acid, dipentyl ester | |
| CCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCC | |
| 306.4 | |
| CHEBI:34680 | |
| 97% |
| 131-18-0 | |
| Colorless to Yellow | |
| 342.0°C | |
| 96% min. (GC) | |
| C18H26O4 | |
| (C(O)OC5H11)2C6H4 | |
| 1.023 | |
| IPKKHRVROFYTEK-UHFFFAOYSA-N | |
| dipentyl benzene-1,2-dicarboxylate | |
| 8561 | |
| 306.4 | |
| Liquid |
Chemical Identifiers
| 131-18-0 | |
| 306.4 | |
| dipentyl phthalate, di-n-pentyl phthalate, diamyl phthalate, amyl phthalate, amoil, di-n-amyl phthalate, di-n-pentylphthalate, phthalic acid, dipentyl ester, phthalic acid diamyl ester, 1,2-benzenedicarboxylic acid, dipentyl ester | |
| CHEBI:34680 | |
| CCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCC |
| C18H26O4 | |
| IPKKHRVROFYTEK-UHFFFAOYSA-N | |
| 8561 | |
| dipentyl benzene-1,2-dicarboxylate |
Safety and Handling
GHS Signal Word: Danger
EINECSNumber : 205-017-9
RUO – Research Use Only