missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Dinonyl phthalate, 96%, mixture of isomers
CAS: 84-76-4 | C26H42O4 | 418.62 g/mol
$259.60 - $259.60
Chemical Identifiers
| CAS | 84-76-4 |
|---|---|
| Molecular Formula | C26H42O4 |
| Molecular Weight (g/mol) | 418.62 |
| MDL Number | MFCD00036237 |
| InChI Key | DROMNWUQASBTFM-UHFFFAOYSA-N |
| Synonym | dinonyl phthalate, dinonylphthalate, nonyl phthalate, di-n-nonyl phthalate, bisoflex dnp, unimoll dn, bisoflex 91, phthalic acid, dinonyl ester, 1,2-benzenedicarboxylic acid, dinonyl ester, bisolflex 91 |
| PubChem CID | 6787 |
| SMILES | CCCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCCC |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC408770250
|
Thermo Scientific Chemicals
408770250 |
25 g | Glass bottle |
Each for $259.60
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 84-76-4 | |
| 418.62 | |
| DROMNWUQASBTFM-UHFFFAOYSA-N | |
| 6787 |
| C26H42O4 | |
| MFCD00036237 | |
| dinonyl phthalate, dinonylphthalate, nonyl phthalate, di-n-nonyl phthalate, bisoflex dnp, unimoll dn, bisoflex 91, phthalic acid, dinonyl ester, 1,2-benzenedicarboxylic acid, dinonyl ester, bisolflex 91 | |
| CCCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCCC |
Specifications
| 84-76-4 | |
| 0.9700g/mL | |
| 216°C | |
| 95% min. (sum of isomers) (GC) | |
| C26H42O4 | |
| MFCD00036237 | |
| 0.97 | |
| Solubility in water: <1g/L (20°) | |
| CCCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCCC | |
| 418.62 | |
| 166 mPa.s (20°C) | |
| 96% | |
| Dinonyl phthalate |
| Yellow to Brown | |
| 279.0°C to 287.0°C | |
| Authentic | |
| Glass bottle | |
| 1.4825 to 1.4845 | |
| 25 g | |
| dinonyl phthalate, dinonylphthalate, nonyl phthalate, di-n-nonyl phthalate, bisoflex dnp, unimoll dn, bisoflex 91, phthalic acid, dinonyl ester, 1,2-benzenedicarboxylic acid, dinonyl ester, bisolflex 91 | |
| DROMNWUQASBTFM-UHFFFAOYSA-N | |
| 1,2-dinonyl benzene-1,2-dicarboxylate | |
| 6787 | |
| 418.61 | |
| Oily Liquid |
Safety and Handling
EINECSNumber : 201-560-
RUO – Research Use Only