missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Dimethyl terephthalate, 99%
CAS: 120-61-6 | C10H10O4 | 194.19 g/mol
$44.79 - $87.27
Chemical Identifiers
| CAS | 120-61-6 |
|---|---|
| Molecular Formula | C10H10O4 |
| Molecular Weight (g/mol) | 194.19 |
| MDL Number | MFCD00008440 |
| InChI Key | WOZVHXUHUFLZGK-UHFFFAOYSA-N |
| Synonym | dimethyl terephthalate, dimethyl p-phthalate, 1,4-benzenedicarboxylic acid, dimethyl ester, dimethyl p-benzenedicarboxylate, di-me terephthalate, dimethyl 4-phthalate, terephthalic acid, dimethyl ester, dimethyl 1,4-benzenedicarboxylate, terephthalic acid dimethyl ester, methyl p-methoxycarbonyl benzoate |
| PubChem CID | 8441 |
| SMILES | COC(=O)C1=CC=C(C=C1)C(=O)OC |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC180580250
|
Thermo Scientific Chemicals
180580250 |
25 g | Plastic bottle |
Each for $44.79
|
|
||||
|
AC180580010
|
Thermo Scientific Chemicals
180580010 |
1 kg | Plastic bottle |
Each for $87.27
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 120-61-6 | |
| 194.19 | |
| WOZVHXUHUFLZGK-UHFFFAOYSA-N | |
| 8441 |
| C10H10O4 | |
| MFCD00008440 | |
| dimethyl terephthalate, dimethyl p-phthalate, 1,4-benzenedicarboxylic acid, dimethyl ester, dimethyl p-benzenedicarboxylate, di-me terephthalate, dimethyl 4-phthalate, terephthalic acid, dimethyl ester, dimethyl 1,4-benzenedicarboxylate, terephthalic acid dimethyl ester, methyl p-methoxycarbonyl benzoate | |
| COC(=O)C1=CC=C(C=C1)C(=O)OC |
Specifications
| 120-61-6 | |
| 140°C to 143°C | |
| 288°C | |
| Authentic | |
| Plastic bottle | |
| MFCD00008440 | |
| 09, 843 | |
| dimethyl terephthalate, dimethyl p-phthalate, 1,4-benzenedicarboxylic acid, dimethyl ester, dimethyl p-benzenedicarboxylate, di-me terephthalate, dimethyl 4-phthalate, terephthalic acid, dimethyl ester, dimethyl 1,4-benzenedicarboxylate, terephthalic acid dimethyl ester, methyl p-methoxycarbonyl benzoate | |
| Solubility in water: 0.036g/L (20°C). Other solubilities: soluble in ether and hot alcohol | |
| COC(=O)C1=CC=C(C=C1)C(=O)OC | |
| 194.19 | |
| 194.19 | |
| Flakes or Pellets |
| 0.03mg KOH/g max. | |
| White | |
| 154°C | |
| 98.5% min. (GC) | |
| C10H10O4 | |
| 25 g | |
| 15, 9305 | |
| 285.0 °C | |
| WOZVHXUHUFLZGK-UHFFFAOYSA-N | |
| dimethyl benzene-1,4-dicarboxylate | |
| 8441 | |
| 99% | |
| Dimethyl terephthalate, 99% |
Safety and Handling
EINECSNumber : 204-411-8
RTECSNumber : WZ1225000
TSCA : TSCA
RUO – Research Use Only