missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Dimethyl isophthalate, 99%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 186515000
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Dimethyl isophthalate | |
| 1459-93-4 | |
| 138°C | |
| 98.5% min. (GC) | |
| C10H10O4 | |
| MFCD00008433 | |
| dimethyl isophthalate, dimethyl m-phthalate, isophthalic acid dimethyl ester, methyl isophthalate, 1,3-benzenedicarboxylic acid, dimethyl ester, morflex 1129, dimethyl 1,3-benzenedicarboxylate, dimethylisophthalate, methyl 3-carbomethoxy benzoate, isophthalic acid, dimethyl ester | |
| VNGOYPQMJFJDLV-UHFFFAOYSA-N | |
| dimethyl benzene-1,3-dicarboxylate | |
| 15088 | |
| 194.19 |
| 99% | |
| 124°C (16.0 hPa) | |
| Authentic | |
| Plastic bottle | |
| C6H4(CO2CH3)2 | |
| 500g | |
| Solubility in water: insoluble | |
| COC(=O)C1=CC(=CC=C1)C(=O)OC | |
| 194.19 | |
| 2.14 mPa.s (99°C) | |
| 99% |
Chemical Identifiers
| 1459-93-4 | |
| 194.19 | |
| VNGOYPQMJFJDLV-UHFFFAOYSA-N | |
| 15088 | |
| COC(=O)C1=CC(=CC=C1)C(=O)OC |
| C10H10O4 | |
| MFCD00008433 | |
| dimethyl isophthalate, dimethyl m-phthalate, isophthalic acid dimethyl ester, methyl isophthalate, 1,3-benzenedicarboxylic acid, dimethyl ester, morflex 1129, dimethyl 1,3-benzenedicarboxylate, dimethylisophthalate, methyl 3-carbomethoxy benzoate, isophthalic acid, dimethyl ester | |
| dimethyl benzene-1,3-dicarboxylate |
Safety and Handling
EINECSNumber : 215-951-9
RTECSNumber : NT2540000
TSCA : TSCA
RUO â Research Use Only