missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Dimethyl isophthalate, 98%
CAS: 1459-93-4 | C10H10O4 | 194.19 g/mol
$34.07 - $236.55
Chemical Identifiers
| CAS | 1459-93-4 |
|---|---|
| Molecular Formula | C10H10O4 |
| Molecular Weight (g/mol) | 194.19 |
| MDL Number | MFCD00008433 |
| InChI Key | VNGOYPQMJFJDLV-UHFFFAOYSA-N |
| Synonym | dimethyl isophthalate, dimethyl m-phthalate, isophthalic acid dimethyl ester, methyl isophthalate, 1,3-benzenedicarboxylic acid, dimethyl ester, morflex 1129, dimethyl 1,3-benzenedicarboxylate, dimethylisophthalate, methyl 3-carbomethoxy benzoate, isophthalic acid, dimethyl ester |
| PubChem CID | 15088 |
| IUPAC Name | dimethyl benzene-1,3-dicarboxylate |
| SMILES | COC(=O)C1=CC(=CC=C1)C(=O)OC |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAB2377922
|
Thermo Scientific Chemicals
B2377922 |
100 g |
Each for $34.07
|
|
|||||
|
AAB2377936
|
Thermo Scientific Chemicals
B2377936 |
500 g |
Each for $82.08
|
|
|||||
|
AAB237790E
|
Thermo Scientific Chemicals
B237790E |
2500 g |
Each for $236.55
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 1459-93-4 | |
| 194.19 | |
| VNGOYPQMJFJDLV-UHFFFAOYSA-N | |
| 15088 | |
| COC(=O)C1=CC(=CC=C1)C(=O)OC |
| C10H10O4 | |
| MFCD00008433 | |
| dimethyl isophthalate, dimethyl m-phthalate, isophthalic acid dimethyl ester, methyl isophthalate, 1,3-benzenedicarboxylic acid, dimethyl ester, morflex 1129, dimethyl 1,3-benzenedicarboxylate, dimethylisophthalate, methyl 3-carbomethoxy benzoate, isophthalic acid, dimethyl ester | |
| dimethyl benzene-1,3-dicarboxylate |
Specifications
| 1459-93-4 | |
| 1.194 | |
| 138°C (280°F) | |
| C10H10O4 | |
| 100 g | |
| dimethyl isophthalate, dimethyl m-phthalate, isophthalic acid dimethyl ester, methyl isophthalate, 1,3-benzenedicarboxylic acid, dimethyl ester, morflex 1129, dimethyl 1,3-benzenedicarboxylate, dimethylisophthalate, methyl 3-carbomethoxy benzoate, isophthalic acid, dimethyl ester | |
| COC(=O)C1=CC(=CC=C1)C(=O)OC | |
| 194.19 | |
| 194.19 | |
| Dimethyl isophthalate |
| 67°C to 70°C | |
| 282°C | |
| Mild | |
| MFCD00008433 | |
| 1912251 | |
| VNGOYPQMJFJDLV-UHFFFAOYSA-N | |
| dimethyl benzene-1,3-dicarboxylate | |
| 15088 | |
| 98% |
Safety and Handling
P264b-P280-P305+P351+P338-P501c
H320
EINECSNumber : 215-951-9
RTECSNumber : NT2540000
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only