missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Diethyl Phthalate, NF, 98-102%, Spectrum™ Chemical
D1097, 84-66-2, C12H14O4
Supplier: Spectrum Chemical Mfg Cor D1097200LTBL
Description
Spectrum™ Chemical Diethyl Phthalate, NF - Spectrum Chemical NF products are manufactured, packaged and stored under current Good Manufacturing Practices (cGMP) per 21CFR part 211 in FDA registered and inspected facilities.Specifications
| 84-66-2 | |
| 0.02% | |
| C12H14O4 | |
| 200 L | |
| FLKPEMZONWLCSK-UHFFFAOYSA-N | |
| 1,2-diethyl benzene-1,2-dicarboxylate | |
| 98 to 102% | |
| Liquid |
| 100% | |
| Amber Glass Bottle | |
| 1.500-1.505 | |
| 1.118-1.122 | |
| CCOC(=O)C1=CC=CC=C1C(=O)OCC | |
| 222.24 | |
| NF |
Chemical Identifiers
| 84-66-2 | |
| 222.24 | |
| 1,2-diethyl benzene-1,2-dicarboxylate |
| C12H14O4 | |
| FLKPEMZONWLCSK-UHFFFAOYSA-N | |
| CCOC(=O)C1=CC=CC=C1C(=O)OCC |