missing translation for 'onlineSavingsMsg'
Learn More
Learn More
(-)-Diethyl D-tartrate, 99%, made from unnatural tartaric acid
CAS: 13811-71-7 | C8H14O6 | 206.19 g/mol
Supplier: Thermo Scientific Chemicals 200340050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| (-)-Diethyl D-tartrate | |
| 13811-71-7 | |
| 100.0 | |
| Colorless | |
| 280.0°C | |
| Authentic | |
| Glass bottle | |
| 1.4450 to 1.4470 | |
| MFCD00064451 | |
| 03, I, 181 | |
| 1.2 | |
| − 9.00 | |
| Solubility in water: insoluble. Other solubilities: soluble in organic solvents | |
| CCOC(=O)[C@@H](O)[C@H](O)C(=O)OCC | |
| 206.19 | |
| 206.19 | |
| Viscous Liquid |
| Made from unnatural tartaric acid | |
| 98.5 | |
| 17.0°C | |
| 1.2000g/mL | |
| 93°C | |
| 98.5% min. (GC) | |
| C8H14O6 | |
| [-CH(OH)CO2C2H5]2 | |
| 5 mL | |
| 11,181; 13,202; 16,54 | |
| −9° (20°C neat) | |
| --diethyl d-tartrate, 2s,3s-diethyl 2,3-dihydroxysuccinate, diethyl d-tartrate, d---tartaric acid diethyl ester, diethyl d---tartrate, diethyl-d-tartrate, diethyl 2s,3s-2,3-dihydroxybutanedioate, 2s,3s--dihydroxybutane-1,4-dioic acid diethyl ester, --diethyl-d-tartrate, diethyl s-r*,r*-tartrate | |
| YSAVZVORKRDODB-WDSKDSINSA-N | |
| diethyl (2S,3S)-2,3-dihydroxybutanedioate | |
| 117410 | |
| 99% |
Chemical Identifiers
| 13811-71-7 | |
| 206.19 | |
| YSAVZVORKRDODB-WDSKDSINSA-N | |
| 117410 | |
| CCOC(=O)[C@@H](O)[C@H](O)C(=O)OCC |
| C8H14O6 | |
| MFCD00064451 | |
| --diethyl d-tartrate, 2s,3s-diethyl 2,3-dihydroxysuccinate, diethyl d-tartrate, d---tartaric acid diethyl ester, diethyl d---tartrate, diethyl-d-tartrate, diethyl 2s,3s-2,3-dihydroxybutanedioate, 2s,3s--dihydroxybutane-1,4-dioic acid diethyl ester, --diethyl-d-tartrate, diethyl s-r*,r*-tartrate | |
| diethyl (2S,3S)-2,3-dihydroxybutanedioate |
Safety and Handling
EINECSNumber : 237-458-8
RUO – Research Use Only