missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Diethyl acetylsuccinate, 99%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 113951000
| Quantity | 100g |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| C10H16O5 | |
| MFCD00009157 | |
| diethyl 2-acetylsuccinate, diethyl acetylsuccinate, ethyl acetylsuccinate, diethyl acetosuccinate, butanedioic acid, acetyl-, diethyl ester, acetylsuccinic acid diethyl ester, diethylacetylsuccinate, 1,4-diethyl 2-acetylbutanedioate, succinic acid, acetyl-, diethyl ester, butanedioic acid, 2-acetyl-, 1,4-diethyl ester | |
| diethyl 2-acetylbutanedioate |
Specifications
| Diethyl acetylsuccinate | |
| 1.0800g/mL | |
| >112°C | |
| 99% | |
| C10H16O5 | |
| C2H5O2CCH2CH(COCH3)CO2C2H5 | |
| MFCD00009157 | |
| 1.08 | |
| Solubility in water: 15g/L (20°C) | |
| CCOC(=O)CC(C(=O)C)C(=O)OCC | |
| 216.23 | |
| 216.23 |
| 1115-30-6 | |
| 180°C to 183°C (50.0mmHg) | |
| Authentic | |
| Glass bottle | |
| 1.4340 to 1.436 | |
| 100g | |
| 03, 801 | |
| diethyl 2-acetylsuccinate, diethyl acetylsuccinate, ethyl acetylsuccinate, diethyl acetosuccinate, butanedioic acid, acetyl-, diethyl ester, acetylsuccinic acid diethyl ester, diethylacetylsuccinate, 1,4-diethyl 2-acetylbutanedioate, succinic acid, acetyl-, diethyl ester, butanedioic acid, 2-acetyl-, 1,4-diethyl ester | |
| DVSDDICSXBCMQJ-UHFFFAOYSA-N | |
| diethyl 2-acetylbutanedioate | |
| 66197 | |
| 99% |
Safety and Handling
EINECSNumber : 214-223-8