missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Didecyl phthalate, 95%
CAS: 84-77-5 | C28H46O4 | 446.67 g/mol
Supplier: Thermo Scientific Chemicals 407100250
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Didecyl phthalate | |
| 84-77-5 | |
| 0.9700g/mL | |
| 232°C | |
| 94% min. (GC) | |
| C28H46O4 | |
| MFCD00041915 | |
| 0.97 | |
| Solubility in water: insoluble | |
| CCCCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCCCC | |
| 446.67 | |
| CHEBI:34676 | |
| 95% |
| 95% | |
| 4.0°C | |
| 261.0°C (5.0 mmHg) | |
| Authentic | |
| Glass bottle | |
| 1.4790 to 1.4840 | |
| 25 g | |
| didecyl phthalate, decyl phthalate, di-n-decyl phthalate, vinicizer 105, phthalic acid, didecyl ester, vinysize 105, 1,2-benzenedicarboxylic acid, didecyl ester, bis n-decyl phthalate, didecyl 1,2-benzenedicarboxylate, unii-fi5fbn947z | |
| PGIBJVOPLXHHGS-UHFFFAOYSA-N | |
| didecyl benzene-1,2-dicarboxylate | |
| 6788 | |
| 446.66 | |
| Liquid |
Chemical Identifiers
| 84-77-5 | |
| 446.67 | |
| PGIBJVOPLXHHGS-UHFFFAOYSA-N | |
| 6788 | |
| didecyl benzene-1,2-dicarboxylate |
| C28H46O4 | |
| MFCD00041915 | |
| didecyl phthalate, decyl phthalate, di-n-decyl phthalate, vinicizer 105, phthalic acid, didecyl ester, vinysize 105, 1,2-benzenedicarboxylic acid, didecyl ester, bis n-decyl phthalate, didecyl 1,2-benzenedicarboxylate, unii-fi5fbn947z | |
| CHEBI:34676 | |
| CCCCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCCCC |
Safety and Handling
EINECSNumber : 201-561-6
RTECSNumber : TI0900000
TSCA : TSCA
RUO – Research Use Only