missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Dibenzyl phosphate, 98%
CAS: 1623-08-1 | C14H15O4P | 278.23 g/mol
$54.59 - $542.94
Chemical Identifiers
| CAS | 1623-08-1 |
|---|---|
| Molecular Formula | C14H15O4P |
| Molecular Weight (g/mol) | 278.23 |
| MDL Number | MFCD00004775 |
| InChI Key | HDFFVHSMHLDSLO-UHFFFAOYSA-N |
| Synonym | dibenzyl phosphate, phosphoric acid dibenzyl ester, dibenzylphosphoric acid, unii-y65r35lz0s, phosphoric acid, bis phenylmethyl ester, dibenzylphosphate, creatine phosphate disodium impurity 4, dibenzyloxyphosphinic acid, dibenzyl-phosphate, pubchem14883 |
| PubChem CID | 74189 |
| IUPAC Name | dibenzyl hydrogen phosphate |
| SMILES | C1=CC=C(C=C1)COP(=O)(O)OCC2=CC=CC=C2 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC112650010
|
Thermo Scientific Chemicals
112650010 |
1 g | Glass bottle |
Each for $54.59
|
|
||||
|
AC112650050
|
Thermo Scientific Chemicals
112650050 |
5 g | Glass bottle |
Each for $162.03
|
|
||||
|
AC112650250
|
Thermo Scientific Chemicals
112650250 |
25 g | Glass bottle |
Each for $542.94
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 1623-08-1 | |
| 278.23 | |
| HDFFVHSMHLDSLO-UHFFFAOYSA-N | |
| 74189 | |
| C1=CC=C(C=C1)COP(=O)(O)OCC2=CC=CC=C2 |
| C14H15O4P | |
| MFCD00004775 | |
| dibenzyl phosphate, phosphoric acid dibenzyl ester, dibenzylphosphoric acid, unii-y65r35lz0s, phosphoric acid, bis phenylmethyl ester, dibenzylphosphate, creatine phosphate disodium impurity 4, dibenzyloxyphosphinic acid, dibenzyl-phosphate, pubchem14883 | |
| dibenzyl hydrogen phosphate |
Specifications
| 1623-08-1 | |
| White to Yellow | |
| 98% | |
| C14H15O4P | |
| MFCD00004775 | |
| 06, 439 | |
| HDFFVHSMHLDSLO-UHFFFAOYSA-N | |
| dibenzyl hydrogen phosphate | |
| 74189 | |
| 98% | |
| Dibenzyl phosphate, 99% |
| 76.0°C to 80.0°C | |
| Authentic | |
| Glass bottle | |
| (C6H5CH2O)2P(O)OH | |
| 1 g | |
| dibenzyl phosphate, phosphoric acid dibenzyl ester, dibenzylphosphoric acid, unii-y65r35lz0s, phosphoric acid, bis phenylmethyl ester, dibenzylphosphate, creatine phosphate disodium impurity 4, dibenzyloxyphosphinic acid, dibenzyl-phosphate, pubchem14883 | |
| C1=CC=C(C=C1)COP(=O)(O)OCC2=CC=CC=C2 | |
| 278.23 | |
| 278.23 | |
| Powder |
Safety and Handling
EINECSNumber : 216-602-3
RUO – Research Use Only