Learn More
Dibenzothiophene, 98%
CAS: 132-65-0 | C12H8S | 184.26 g/mol
$107.94 - $722.66
Chemical Identifiers
| CAS | 132-65-0 |
|---|---|
| Molecular Formula | C12H8S |
| Molecular Weight (g/mol) | 184.26 |
| MDL Number | MFCD00004969 |
| InChI Key | IYYZUPMFVPLQIF-UHFFFAOYSA-N |
| Synonym | diphenylene sulfide, dibenzo b,d thiophene, 9-thiafluorene, alpha-thiafluorene, 2,2'-biphenylylene sulfide, usan, unii-z3d4aj1r48, 1,1'-biphenyl-2,2'-diyl sulfide, .alpha.-thiafluorene |
| PubChem CID | 3023 |
| ChEBI | CHEBI:23681 |
| IUPAC Name | dibenzothiophene |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3S2 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC112540250
|
Thermo Scientific Chemicals
112540250 |
25 g | Plastic bottle |
Each for $107.94
|
|
||||
|
AC112541000
|
Thermo Scientific Chemicals
112541000 |
100 g | Plastic bottle |
Each for $319.02
|
|
||||
|
AC112542500
|
Thermo Scientific Chemicals
112542500 |
250 g | Plastic bottle |
Each for $722.66
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 132-65-0 | |
| 184.26 | |
| IYYZUPMFVPLQIF-UHFFFAOYSA-N | |
| 3023 | |
| dibenzothiophene |
| C12H8S | |
| MFCD00004969 | |
| diphenylene sulfide, dibenzo b,d thiophene, 9-thiafluorene, alpha-thiafluorene, 2,2'-biphenylylene sulfide, usan, unii-z3d4aj1r48, 1,1'-biphenyl-2,2'-diyl sulfide, .alpha.-thiafluorene | |
| CHEBI:23681 | |
| C1=CC=C2C(=C1)C3=CC=CC=C3S2 |
Specifications
| 132-65-0 | |
| Gray-Green to White | |
| 170°C | |
| 97.5% min. (GC) | |
| C12H8S | |
| 25 g | |
| diphenylene sulfide, dibenzo b,d thiophene, 9-thiafluorene, alpha-thiafluorene, 2,2'-biphenylylene sulfide, usan, unii-z3d4aj1r48, 1,1'-biphenyl-2,2'-diyl sulfide, .alpha.-thiafluorene | |
| IYYZUPMFVPLQIF-UHFFFAOYSA-N | |
| dibenzothiophene | |
| 3023 | |
| 184.26 | |
| Crystalline Powder and/or Chunks |
| 97°C to 100°C | |
| 332°C to 333°C | |
| Authentic | |
| Plastic bottle | |
| MFCD00004969 | |
| 17,72 | |
| Solubility in water: soluble. Other solubilities: soluble in ethanol,benzene,chloroform | |
| C1=CC=C2C(=C1)C3=CC=CC=C3S2 | |
| 184.26 | |
| CHEBI:23681 | |
| 98% | |
| Dibenzothiophene |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Very toxic to aquatic life with long lasting effects.
GHS P Statement
Wash face,hands and any exposed skin thoroughly after handling.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
Avoid release to the environment.
Collect spillage.
Dispose of contents/
GHS Signal Word: Warning
EINECSNumber : 205-072-9
RUO – Research Use Only