Learn More
Dibenzothiophene, 98%
CAS: 132-65-0 | C12H8S | 184.26 g/mol
Supplier: Thermo Scientific Chemicals 112541000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Dibenzothiophene | |
| 97°C to 100°C | |
| 332°C to 333°C | |
| Authentic | |
| Plastic bottle | |
| MFCD00004969 | |
| 17,72 | |
| Solubility in water: soluble. Other solubilities: soluble in ethanol,benzene,chloroform | |
| C1=CC=C2C(=C1)C3=CC=CC=C3S2 | |
| 184.26 | |
| CHEBI:23681 | |
| 98% |
| 132-65-0 | |
| Gray-Green to White | |
| 170°C | |
| 97.5% min. (GC) | |
| C12H8S | |
| 100 g | |
| diphenylene sulfide, dibenzo b,d thiophene, 9-thiafluorene, alpha-thiafluorene, 2,2'-biphenylylene sulfide, usan, unii-z3d4aj1r48, 1,1'-biphenyl-2,2'-diyl sulfide, .alpha.-thiafluorene | |
| IYYZUPMFVPLQIF-UHFFFAOYSA-N | |
| dibenzothiophene | |
| 3023 | |
| 184.26 | |
| Crystalline Powder and/or Chunks |
Chemical Identifiers
| 132-65-0 | |
| 184.26 | |
| IYYZUPMFVPLQIF-UHFFFAOYSA-N | |
| 3023 | |
| dibenzothiophene |
| C12H8S | |
| MFCD00004969 | |
| diphenylene sulfide, dibenzo b,d thiophene, 9-thiafluorene, alpha-thiafluorene, 2,2'-biphenylylene sulfide, usan, unii-z3d4aj1r48, 1,1'-biphenyl-2,2'-diyl sulfide, .alpha.-thiafluorene | |
| CHEBI:23681 | |
| C1=CC=C2C(=C1)C3=CC=CC=C3S2 |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Very toxic to aquatic life with long lasting effects.
GHS P Statement
Wash face,hands and any exposed skin thoroughly after handling.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
Avoid release to the environment.
Collect spillage.
Dispose of contents/
GHS Signal Word: Warning
EINECSNumber : 205-072-9
RUO – Research Use Only