missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Di-tert-butyl malonate, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 406620100
| Quantity | 10g |
|---|
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| C11H20O4 | |
| MFCD00008810 | |
| di-tert-butyl malonate, malonic acid di-tert-butyl ester, propanedioic acid, bis 1,1-dimethylethyl ester, di-t-butylmalonate, di-t-butyl malonate, unii-7e9xwt9380, 1,3-di-tert-butyl propanedioate, di tert-butyl malonate, tert-butyl 2-tert-butoxycarbonyl acetate, di-tert-butyl malonate, stab. with potassium carbonate | |
| ditert-butyl propanedioate |
Specifications
| Di-tert-butyl malonate | |
| 0.9660g/mL | |
| 88°C | |
| 97.5% min. (GC) | |
| C11H20O4 | |
| 1.4175 to 1.4195 | |
| MFCD00008810 | |
| 01,210 | |
| 15, 3041 | |
| CLPHAYNBNTVRDI-UHFFFAOYSA-N | |
| ditert-butyl propanedioate | |
| 68324 | |
| 98% |
| 541-16-2 | |
| 110°C to 111°C (22.0mmHg) | |
| Authentic | |
| Glass bottle | |
| CH2(CO2C(CH3)3)2 | |
| 10g | |
| 02, III, 1621 | |
| 0.966 | |
| di-tert-butyl malonate, malonic acid di-tert-butyl ester, propanedioic acid, bis 1,1-dimethylethyl ester, di-t-butylmalonate, di-t-butyl malonate, unii-7e9xwt9380, 1,3-di-tert-butyl propanedioate, di tert-butyl malonate, tert-butyl 2-tert-butoxycarbonyl acetate, di-tert-butyl malonate, stab. with potassium carbonate | |
| CC(C)(C)OC(=O)CC(=O)OC(C)(C)C | |
| 216.28 | |
| 216.28 |
Safety and Handling
EINECSNumber : 208-769-6