Learn More
Di-n-octyl phthalate, 98%
Plasticizer | CAS: 117-84-0 | C24H38O4 | 390.564 g/mol
Supplier: Thermo Scientific Chemicals 041522AE
Description
Di-n-octyl phthalate is used as a plasticizer for many resins and elastomers. It acts as an additive. It is also used for medical tubing and blood storage bags, wire and cables, carpet back coating, floor tile and in cosmetics.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Di-n-octyl phthalate | |
| -25°C | |
| 0.98 g/mL | |
| 219°C (426°F) | |
| C24H38O4 | |
| 100 mL | |
| dioctyl phthalate, di-n-octyl phthalate, dinopol nop, n-octyl phthalate, vinicizer 85, phthalic acid, dioctyl ester, polycizer 162, dnop, phthalic acid di-n-octyl ester, dioctyl 1,2-benzenedicarboxylate | |
| MQIUGAXCHLFZKX-UHFFFAOYSA-N | |
| dioctyl benzene-1,2-dicarboxylate | |
| 8346 | |
| 390.56 | |
| Liquid |
| 117-84-0 | |
| Colorless to Yellow | |
| 380°C | |
| 98% | |
| MFCD00015292 | |
| 14,2864 | |
| Insoluble in water. | |
| CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC | |
| 390.564 | |
| CHEBI:34679 | |
| 98% |
Chemical Identifiers
| 117-84-0 | |
| 390.564 | |
| MQIUGAXCHLFZKX-UHFFFAOYSA-N | |
| 8346 | |
| dioctyl benzene-1,2-dicarboxylate |
| C24H38O4 | |
| MFCD00015292 | |
| dioctyl phthalate, di-n-octyl phthalate, dinopol nop, n-octyl phthalate, vinicizer 85, phthalic acid, dioctyl ester, polycizer 162, dnop, phthalic acid di-n-octyl ester, dioctyl 1,2-benzenedicarboxylate | |
| CHEBI:34679 | |
| CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC |
Safety and Handling
EINECSNumber : 204-214-7
RTECSNumber : TI1925000
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only