missing translation for 'onlineSavingsMsg'
Learn More
Learn More
MilliporeSigma™ DAF-FM, Calbiochem™,
A photo-stable nitric oxide (NO) fluorescent indicator with a detection limit of approx. 3nM
Supplier: MilliporeSigma™ 2515151MG
Specifications
| DAF-FM | |
| Yellow | |
| 1 mg | |
| DIJCILWNOLHJCG-UHFFFAOYSA-N | |
| 7-amino-2',7'-difluoro-3',6'-dihydroxy-6-(methylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one | |
| 10431792 | |
| ≥98% | |
| 5mM solution in DMSO |
| 254109-20-1 | |
| C21H14F2N2O5 | |
| daf-fm, 3-amino, 4-aminomethyl-2′,7′-difluorofluorescein, daf-fm hplc, 4-amino-5-methylamino-2',7'-difluorescein, 4-amino-5-methylamino-2',7'-difluorofluorescein, 7-amino-2',7'-difluoro-3',6'-dihydroxy-6-methylamino spiro, 4-amino-2',7'-difluoro-3',6'-dihydroxy-5-methylamino spiro 2-benzofuran-1,9'-xanthen-3-one, 4-amino-5-n-methylamino-2',7'-difluoro-3',6'-dihydroxy-spiro isobenzofuran-1 3h ,9'-9h xanthen-3-one, 4-amino-5-methylamino-2 inverted exclamation marka,7 inverted exclamation marka-difluorescein | |
| CNC1=C(C2=C(C=C1)C3(C4=CC(=C(C=C4OC5=CC(=C(C=C53)F)O)O)F)OC2=O)N | |
| 412.349 | |
| 412.4 | |
| HPLC | |
| Liquid |
Chemical Identifiers
| 254109-20-1 | |
| 412.349 | |
| daf-fm, 3-amino, 4-aminomethyl-2′,7′-difluorofluorescein, daf-fm hplc, 4-amino-5-methylamino-2',7'-difluorescein, 4-amino-5-methylamino-2',7'-difluorofluorescein, 7-amino-2',7'-difluoro-3',6'-dihydroxy-6-methylamino spiro, 4-amino-2',7'-difluoro-3',6'-dihydroxy-5-methylamino spiro 2-benzofuran-1,9'-xanthen-3-one, 4-amino-5-n-methylamino-2',7'-difluoro-3',6'-dihydroxy-spiro isobenzofuran-1 3h ,9'-9h xanthen-3-one, 4-amino-5-methylamino-2 inverted exclamation marka,7 inverted exclamation marka-difluorescein | |
| 7-amino-2',7'-difluoro-3',6'-dihydroxy-6-(methylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
| C21H14F2N2O5 | |
| DIJCILWNOLHJCG-UHFFFAOYSA-N | |
| 10431792 | |
| CNC1=C(C2=C(C=C1)C3(C4=CC(=C(C=C4OC5=CC(=C(C=C53)F)O)O)F)OC2=O)N |
Safety and Handling
RTECSNumber : PV6210000
Recommended Storage : -20°C (-4°F); Keep container tightly closed. Keep container in a cool, well-ventilated area. Do not store above -20°C (-4°F).