missing translation for 'onlineSavingsMsg'
Learn More
Learn More
D-Serine methyleester hydrochloride, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 396790250
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| D-Serine methyl ester hydrochloride | |
| Authentic | |
| C23H19Br2N3O3S | |
| HOCH2CH(NH2)CO2CH3·HCl | |
| −2.5° to −4.5° (20°C, 589nm) (C=4, methanol) | |
| LYRWWUCOZBTOPL-UHFFFAOYNA-N | |
| methyl (2R)-2-amino-3-hydroxypropanoate;hydrochloride | |
| 577.29 | |
| 155.58 |
| 5874-57-7 | |
| 98% | |
| Glass bottle | |
| MFCD00066121 | |
| d-serine methyl ester hydrochloride, h-d-ser-ome.hcl, r-methyl 2-amino-3-hydroxypropanoate hydrochloride, d-serine, methyl ester, hydrochloride, d-serine methyl ester hcl, methyl 2r-2-amino-3-hydroxypropanoate hydrochloride, d-ser-ome hcl, cycloserine impurity 2, h-d-ser-ome.hci | |
| CC(N(C)S(=O)(=O)C1=CC=C(Br)C=C1)C1=NC2=CC=CC=C2C(=O)N1C1=CC=C(Br)C=C1 | |
| 25g | |
| 11446470 | |
| 98% |
Chemical Identifiers
| 5874-57-7 | |
| 577.29 | |
| LYRWWUCOZBTOPL-UHFFFAOYNA-N | |
| 11446470 | |
| CC(N(C)S(=O)(=O)C1=CC=C(Br)C=C1)C1=NC2=CC=CC=C2C(=O)N1C1=CC=C(Br)C=C1 |
| C23H19Br2N3O3S | |
| MFCD00066121 | |
| d-serine methyl ester hydrochloride, h-d-ser-ome.hcl, r-methyl 2-amino-3-hydroxypropanoate hydrochloride, d-serine, methyl ester, hydrochloride, d-serine methyl ester hcl, methyl 2r-2-amino-3-hydroxypropanoate hydrochloride, d-ser-ome hcl, cycloserine impurity 2, h-d-ser-ome.hci | |
| methyl (2R)-2-amino-3-hydroxypropanoate;hydrochloride |
RUO â Research Use Only