missing translation for 'onlineSavingsMsg'
Learn More
Learn More
D-(+)-Maltose Monohydrate, Fisher BioReagents
Supplier: Fisher BioReagents FLBP684500
Description
Maltose is suitable for use in cell culture systems requiring sugar additives.Specifications
| Maltose Monohydrate | |
| 6363-53-7 | |
| Colorless | |
| record% | |
| Poly Bottle | |
| MFCD00149343 | |
| 128 to 132° (+ or -) | |
| HBDJFVFTHLOSDW-UHFFFAOYNA-N | |
| 2,3,5,6-tetrahydroxy-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}hexanal hydrate | |
| 360.29 | |
| Solid |
| D-(+)-Maltose Monohydrate | |
| 130°C | |
| 5.5 | |
| ≥97 % | |
| C12H24O12 | |
| 500 g | |
| d-+-maltose monohydrate, unii-dm477ee40d, 2r,3r,4r,5r-2,3,5,6-tetrahydroxy-4-2r,3r,4s,5s,6r-3,4,5-trihydroxy-6-hydroxymethyl oxan-2-yl oxy hexanal hydrate, beta-maltose monohydrate, d-+-maltosemonohydrate, 69-79-4 anhydrous, d +-maltose monohydrate, d-+-maltose monohydrate, puriss., d-+-maltose monohydrate, analytical standard, d-+-maltose monohydrate, bioxtra | |
| O.OCC(O)C(OC1OC(CO)C(O)C(O)C1O)C(O)C(O)C=O | |
| 360.31 | |
| ≥97% |
Chemical Identifiers
| 6363-53-7 | |
| 360.31 | |
| HBDJFVFTHLOSDW-UHFFFAOYNA-N | |
| 2,3,5,6-tetrahydroxy-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}hexanal hydrate |
| C12H24O12 | |
| MFCD00149343 | |
| d-+-maltose monohydrate, unii-dm477ee40d, 2r,3r,4r,5r-2,3,5,6-tetrahydroxy-4-2r,3r,4s,5s,6r-3,4,5-trihydroxy-6-hydroxymethyl oxan-2-yl oxy hexanal hydrate, beta-maltose monohydrate, d-+-maltosemonohydrate, 69-79-4 anhydrous, d +-maltose monohydrate, d-+-maltose monohydrate, puriss., d-+-maltose monohydrate, analytical standard, d-+-maltose monohydrate, bioxtra | |
| O.OCC(O)C(OC1OC(CO)C(O)C(O)C1O)C(O)C(O)C=O |
Safety and Handling
Recommended Storage : RT