missing translation for 'onlineSavingsMsg'
Learn More
Learn More
D(+)-Camphoric acid, 99%
CAS: 124-83-4 | C10H14O4-2 | 198.218 g/mol
$180.04 - $180.04
Chemical Identifiers
| CAS | 124-83-4 |
|---|---|
| Molecular Formula | C10H14O4-2 |
| Molecular Weight (g/mol) | 198.218 |
| MDL Number | MFCD00001375 |
| InChI Key | LSPHULWDVZXLIL-LDWIPMOCSA-L |
| Synonym | d-+-camphoric acid, 1r,3s-1,2,2-trimethylcyclopentane-1,3-dicarboxylic acid, d-camphoric acid, 1r,3s-+-camphoric acid, unii-w77rm1csd5, camphoric acid, 1,3-cyclopentanedicarboxylic acid, 1,2,2-trimethyl-, 1r,3s, w77rm1csd5, 1,2,2-trimethyl-1,3-cyclopentanedicarboxylic acid, 1r-cis, 1r,3s-camphoric acid |
| PubChem CID | 6918944 |
| IUPAC Name | (1R,3S)-1,2,2-trimethylcyclopentane-1,3-dicarboxylate |
| SMILES | CC1(C(CCC1(C)C(=O)[O-])C(=O)[O-])C |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC108201000
|
Thermo Scientific Chemicals
108201000 |
100 g | Plastic bottle |
Each for $180.04
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 124-83-4 | |
| 198.218 | |
| LSPHULWDVZXLIL-LDWIPMOCSA-L | |
| 6918944 | |
| CC1(C(CCC1(C)C(=O)[O-])C(=O)[O-])C |
| C10H14O4-2 | |
| MFCD00001375 | |
| d-+-camphoric acid, 1r,3s-1,2,2-trimethylcyclopentane-1,3-dicarboxylic acid, d-camphoric acid, 1r,3s-+-camphoric acid, unii-w77rm1csd5, camphoric acid, 1,3-cyclopentanedicarboxylic acid, 1,2,2-trimethyl-, 1r,3s, w77rm1csd5, 1,2,2-trimethyl-1,3-cyclopentanedicarboxylic acid, 1r-cis, 1r,3s-camphoric acid | |
| (1R,3S)-1,2,2-trimethylcyclopentane-1,3-dicarboxylate |
Specifications
| 183°C to 187°C | |
| White | |
| C10H14O4-2 | |
| 09, 745 | |
| 15, 1735 | |
| LSPHULWDVZXLIL-LDWIPMOCSA-L | |
| (1R,3S)-1,2,2-trimethylcyclopentane-1,3-dicarboxylate | |
| 6918944 | |
| ≥98.5% | |
| Authentic | |
| Crystalline Powder |
| 124-83-4 | |
| 99% | |
| MFCD00001375 | |
| 11,352; 15,67 | |
| d-+-camphoric acid, 1r,3s-1,2,2-trimethylcyclopentane-1,3-dicarboxylic acid, d-camphoric acid, 1r,3s-+-camphoric acid, unii-w77rm1csd5, camphoric acid, 1,3-cyclopentanedicarboxylic acid, 1,2,2-trimethyl-, 1r,3s, w77rm1csd5, 1,2,2-trimethyl-1,3-cyclopentanedicarboxylic acid, 1r-cis, 1r,3s-camphoric acid | |
| CC1(C(CCC1(C)C(=O)[O-])C(=O)[O-])C | |
| 198.218 | |
| 200.23 | |
| 100 g | |
| Plastic bottle | |
| D(+)-Camphoric acid |
RUO – Research Use Only