missing translation for 'onlineSavingsMsg'
Learn More
Learn More
D(+)-Camphoric acid, 99%
CAS: 124-83-4 | C10H14O4-2 | 198.218 g/mol
Supplier: Thermo Scientific Chemicals 108201000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| D(+)-Camphoric acid | |
| 124-83-4 | |
| 99% | |
| MFCD00001375 | |
| 11,352; 15,67 | |
| d-+-camphoric acid, 1r,3s-1,2,2-trimethylcyclopentane-1,3-dicarboxylic acid, d-camphoric acid, 1r,3s-+-camphoric acid, unii-w77rm1csd5, camphoric acid, 1,3-cyclopentanedicarboxylic acid, 1,2,2-trimethyl-, 1r,3s, w77rm1csd5, 1,2,2-trimethyl-1,3-cyclopentanedicarboxylic acid, 1r-cis, 1r,3s-camphoric acid | |
| CC1(C(CCC1(C)C(=O)[O-])C(=O)[O-])C | |
| 198.218 | |
| 200.23 | |
| 100 g | |
| Plastic bottle |
| 183°C to 187°C | |
| White | |
| C10H14O4-2 | |
| 09, 745 | |
| 15, 1735 | |
| LSPHULWDVZXLIL-LDWIPMOCSA-L | |
| (1R,3S)-1,2,2-trimethylcyclopentane-1,3-dicarboxylate | |
| 6918944 | |
| ≥98.5% | |
| Authentic | |
| Crystalline Powder |
Chemical Identifiers
| 124-83-4 | |
| 198.218 | |
| LSPHULWDVZXLIL-LDWIPMOCSA-L | |
| 6918944 | |
| CC1(C(CCC1(C)C(=O)[O-])C(=O)[O-])C |
| C10H14O4-2 | |
| MFCD00001375 | |
| d-+-camphoric acid, 1r,3s-1,2,2-trimethylcyclopentane-1,3-dicarboxylic acid, d-camphoric acid, 1r,3s-+-camphoric acid, unii-w77rm1csd5, camphoric acid, 1,3-cyclopentanedicarboxylic acid, 1,2,2-trimethyl-, 1r,3s, w77rm1csd5, 1,2,2-trimethyl-1,3-cyclopentanedicarboxylic acid, 1r-cis, 1r,3s-camphoric acid | |
| (1R,3S)-1,2,2-trimethylcyclopentane-1,3-dicarboxylate |
RUO – Research Use Only