Learn More
D(+)-Camphor, 97%
CAS: 464-49-3 | C10H16O | 152.24 g/mol
Supplier: Thermo Scientific Chemicals 227845000
| Quantity | 500 g |
|---|---|
| Packaging | Plastic bottle |
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 464-49-3 | |
| 152.24 | |
| DSSYKIVIOFKYAU-XVKPBYJWSA-N | |
| 159055 | |
| (1R,4R)-4,7,7-trimethylbicyclo[2.2.1]heptan-3-one |
| C10H16O | |
| MFCD00064149,MFCD00074738,MFCD00064149,MFCD00064149 | |
| +-camphor, d-camphor, 1r-+-camphor, r-camphor, +-bornan-2-one, r-+-camphor, 1r,4r-1,7,7-trimethylbicyclo 2.2.1 heptan-2-one, 1r,4r-camphor, camphor d, +-2-bornanone | |
| CHEBI:15396 | |
| CC1(C)[C@H]2CC[C@@]1(C)C(=O)C2 |
Specifications
| D(+)-Camphor | |
| 464-49-3 | |
| White | |
| 64°C | |
| 96% min. (GC) | |
| C10H16O | |
| MFCD00064149,MFCD00074738,MFCD00064149,MFCD00064149 | |
| 15, 1734 | |
| +-camphor, d-camphor, 1r-+-camphor, r-camphor, +-bornan-2-one, r-+-camphor, 1r,4r-1,7,7-trimethylbicyclo 2.2.1 heptan-2-one, 1r,4r-camphor, camphor d, +-2-bornanone | |
| DSSYKIVIOFKYAU-XVKPBYJWSA-N | |
| (1R,4R)-4,7,7-trimethylbicyclo[2.2.1]heptan-3-one | |
| 159055 | |
| 152.24 | |
| Crystals |
| 97% | |
| 176.0°C to 180.0°C | |
| 204.0°C | |
| Authentic | |
| Plastic bottle | |
| 500 g | |
| 13,61 | |
| + 42.50 | |
| Solubility in water: 1g/800mL water (25°C) (giving a colloidal solutio. Other solubilities: at 25°C 1 g dissolves in 1 mL alcohol,1 mL ether,,0.5 mL chloroform,0.4 mL benzene,0.4 mL acetone,,1.5 mL turpentine oil,0.5 mL glacial acetic acid | |
| CC1(C)[C@H]2CC[C@@]1(C)C(=O)C2 | |
| 152.24 | |
| CHEBI:15396 | |
| 97% |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
Flammable solid.
Harmful if swallowed.
GHS P Statement
Keep away from heat/sparks/open flames/hot surfaces.
- No smoking.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cauti
GHS Signal Word: Warning
EINECSNumber : 207-355-2
RTECSNumber : EX1260000
TSCA : TSCA