Learn More
Alfa Aesar™ Cycloheximide, ultrapure, 95%
A protein synthesis inhibitor in eukaryotic cells
Manufacturer: Alfa Aesar™ J6690103
Specifications
| Cycloheximide | |
| 66-81-9 | |
| MFCD00082346 | |
| 88868 | |
| 3-[2-(3,5-Dimethyl-2-oxocyclohexyl)-2-hydroxyethyl]glutarimide; Actidione | |
| YPHMISFOHDHNIV-FSZOTQKASA-N | |
| 4-[(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]piperidine-2,6-dione | |
| 6197 | |
| 281.35 | |
| 95% | |
| White to Cream | |
| 1g |
| Ultrapure | |
| C15H23NO4 | |
| UN2811 | |
| 14,2728 | |
| Soluble in DMSO, acetone, ethanol and methanol; Slightly soluble in water with sonication | |
| CC1CC(C(=O)C(C1)C(CC2CC(=O)NC(=O)C2)O)C | |
| 281.352 | |
| CHEBI:27641 | |
| Powder | |
| 492°C | |
| 111°C to 116°C |
Chemical Identifiers
| 66-81-9 | |
| 281.352 | |
| YPHMISFOHDHNIV-FSZOTQKASA-N | |
| 6197 | |
| 4-[(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]piperidine-2,6-dione |
| C15H23NO4 | |
| MFCD00082346 | |
| 3-[2-(3,5-Dimethyl-2-oxocyclohexyl)-2-hydroxyethyl]glutarimide; Actidione | |
| CHEBI:27641 | |
| CC1CC(C(=O)C(C1)C(CC2CC(=O)NC(=O)C2)O)C |
Safety and Handling
GHS H Statement
H300-H360-H341
Fatal if swallowed.
May damage fertility or the unborn child.
Suspected of causing genetic defects.
GHS P Statement
P281-P301+P310-P308+P313-P321-P405-P501a
Use personal protective equipment as required.
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
IF exposed or concerned: Get medical advice/attention.
Specific treatment (see label).
Store locked up.
Dispose of contents/container in accordance with local/regional/national/international regulations.
Danger
DOTInformation : Transport Hazard Class: 6.1; Packaging Group: I; Proper Shipping Name: TOXIC SOLIDS, ORGANIC, N.O.S.
RTECSNumber : MA4375000